EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H7O3 |
| Net Charge | -1 |
| Average Mass | 151.141 |
| Monoisotopic Mass | 151.04007 |
| SMILES | O=C([O-])C(O)c1ccccc1 |
| InChI | InChI=1S/C8H8O3/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7,9H,(H,10,11)/p-1 |
| InChIKey | IWYDHOAUDWTVEP-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mandelate (CHEBI:25147) has functional parent acetate (CHEBI:30089) |
| mandelate (CHEBI:25147) is a hydroxy monocarboxylic acid anion (CHEBI:36059) |
| mandelate (CHEBI:25147) is conjugate base of mandelic acid (CHEBI:35825) |
| Incoming Relation(s) |
| 4-hydroxymandelate (CHEBI:32804) has functional parent mandelate (CHEBI:25147) |
| vanillylmandelate (CHEBI:27622) has functional parent mandelate (CHEBI:25147) |
| (R)-mandelate (CHEBI:32382) is a mandelate (CHEBI:25147) |
| (S)-mandelate (CHEBI:17756) is a mandelate (CHEBI:25147) |
| mandelic acid (CHEBI:35825) is conjugate acid of mandelate (CHEBI:25147) |
| IUPAC Name |
|---|
| hydroxy(phenyl)acetate |
| Synonyms | Source |
|---|---|
| 2-hydroxy-2-(4-hydroxyphenyl)acetate | ChEBI |
| mandelate ion | ChemIDplus |
| α-hydroxybenzeneacetate | ChEBI |
| α-hydroxybenzeneacetic acid, ion(1−) | ChemIDplus |
| UniProt Name | Source |
|---|---|
| mandelate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:328159 | Gmelin |
| Beilstein:3905858 | Beilstein |
| Beilstein:4135334 | Beilstein |
| CAS:769-61-9 | ChemIDplus |