EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11NO2 |
| Net Charge | 0 |
| Average Mass | 153.181 |
| Monoisotopic Mass | 153.07898 |
| SMILES | NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C8H11NO2/c9-4-3-6-1-2-7(10)8(11)5-6/h1-2,5,10-11H,3-4,9H2 |
| InChIKey | VYFYYTLLBUKUHU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. dopaminergic agent A drug used for its effects on dopamine receptors, on the life cycle of dopamine, or on the survival of dopaminergic neurons. |
| Applications: | sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. hypoglycemic agent A drug which lowers the blood glucose level. cardiotonic drug A drug that has a strengthening effect on the heart or that can increase cardiac output. beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. antiparkinson drug A drug used in the treatment of Parkinson's disease. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. dopaminergic agent A drug used for its effects on dopamine receptors, on the life cycle of dopamine, or on the survival of dopaminergic neurons. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dopamine (CHEBI:18243) has role Escherichia coli metabolite (CHEBI:76971) |
| dopamine (CHEBI:18243) has role antidepressant (CHEBI:35469) |
| dopamine (CHEBI:18243) has role antiparkinson drug (CHEBI:48407) |
| dopamine (CHEBI:18243) has role cardiotonic drug (CHEBI:38147) |
| dopamine (CHEBI:18243) has role cardiovascular drug (CHEBI:35554) |
| dopamine (CHEBI:18243) has role dopaminergic agent (CHEBI:48560) |
| dopamine (CHEBI:18243) has role human metabolite (CHEBI:77746) |
| dopamine (CHEBI:18243) has role hypoglycemic agent (CHEBI:35526) |
| dopamine (CHEBI:18243) has role mouse metabolite (CHEBI:75771) |
| dopamine (CHEBI:18243) has role sympathomimetic agent (CHEBI:35524) |
| dopamine (CHEBI:18243) has role β-adrenergic agonist (CHEBI:35522) |
| dopamine (CHEBI:18243) is a catecholamine (CHEBI:33567) |
| dopamine (CHEBI:18243) is conjugate base of dopaminium(1+) (CHEBI:59905) |
| Incoming Relation(s) |
| (2E)-N-[2-(3,4-dihydroxyphenyl)ethyl]-3-(3,4-dimethoxyphenyl)acrylamide (CHEBI:139448) has functional parent dopamine (CHEBI:18243) |
| N-[2-(3,4-dihydroxyphenyl)ethyl]-L-glutamine residue (CHEBI:167175) has functional parent dopamine (CHEBI:18243) |
| N-acetyldopamine (CHEBI:125678) has functional parent dopamine (CHEBI:18243) |
| N-oleoyldopamine (CHEBI:31883) has functional parent dopamine (CHEBI:18243) |
| N-palmitoyl dopamine (CHEBI:134058) has functional parent dopamine (CHEBI:18243) |
| N‐β‐alanyldopamine (CHEBI:125666) has functional parent dopamine (CHEBI:18243) |
| 15-HETE-DA (CHEBI:188286) has functional parent dopamine (CHEBI:18243) |
| 3-methoxytyramine (CHEBI:1582) has functional parent dopamine (CHEBI:18243) |
| 4-methoxytyramine (CHEBI:89641) has functional parent dopamine (CHEBI:18243) |
| Arachidonoyl dopamine (CHEBI:31231) has functional parent dopamine (CHEBI:18243) |
| Dihomo-gamma-linolenoyl dopamine (CHEBI:187455) has functional parent dopamine (CHEBI:18243) |
| dopamantine (CHEBI:751868) has functional parent dopamine (CHEBI:18243) |
| dopamine 3-O-sulfate (CHEBI:37946) has functional parent dopamine (CHEBI:18243) |
| dopamine 4-O-sulfate (CHEBI:34729) has functional parent dopamine (CHEBI:18243) |
| N-[2-(3,4-dihydroxyphenyl)ethyl]-9-octadecenamide (CHEBI:109532) has functional parent dopamine (CHEBI:18243) |
| N-linoleoyl dopamine (CHEBI:183583) has functional parent dopamine (CHEBI:18243) |
| N-stearoyl dopamine (CHEBI:186909) has functional parent dopamine (CHEBI:18243) |
| oxidopamine (CHEBI:78741) has functional parent dopamine (CHEBI:18243) |
| dopaminium(1+) (CHEBI:59905) is conjugate acid of dopamine (CHEBI:18243) |
| IUPAC Name |
|---|
| 4-(2-aminoethyl)benzene-1,2-diol |
| INNs | Source |
|---|---|
| dopamina | ChemIDplus |
| dopamine | ChEBI |
| dopaminum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-(3,4-dihydroxyphenyl)ethylamine | ChEBI |
| 2-(3,4-Dihydroxyphenyl)ethylamine | KEGG COMPOUND |
| 3,4-Dihydroxyphenethylamine | KEGG COMPOUND |
| 3-Hydroxytyramine | ChemIDplus |
| 4-(2-aminoethyl)-1,2-benzenediol | ChEBI |
| 4-(2-Aminoethyl)-1,2-benzenediol | KEGG COMPOUND |
| Citations |
|---|