EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13NO2 |
| Net Charge | 0 |
| Average Mass | 167.208 |
| Monoisotopic Mass | 167.09463 |
| SMILES | COc1ccc(CCN)cc1O |
| InChI | InChI=1S/C9H13NO2/c1-12-9-3-2-7(4-5-10)6-8(9)11/h2-3,6,11H,4-5,10H2,1H3 |
| InChIKey | WJXQFVMTIGJBFX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | PubMed (6518609) | |
| Rattus norvegicus (ncbitaxon:10116) | Urine (NCIT:C13283) | PubMed (404066) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methoxytyramine (CHEBI:89641) has functional parent dopamine (CHEBI:18243) |
| 4-methoxytyramine (CHEBI:89641) has role human metabolite (CHEBI:77746) |
| 4-methoxytyramine (CHEBI:89641) has role rat metabolite (CHEBI:86264) |
| 4-methoxytyramine (CHEBI:89641) is a monomethoxybenzene (CHEBI:25235) |
| 4-methoxytyramine (CHEBI:89641) is a phenols (CHEBI:33853) |
| 4-methoxytyramine (CHEBI:89641) is a phenylethylamine (CHEBI:50048) |
| 4-methoxytyramine (CHEBI:89641) is a primary amino compound (CHEBI:50994) |
| 4-methoxytyramine (CHEBI:89641) is conjugate base of 4-methoxytyraminium (CHEBI:192993) |
| Incoming Relation(s) |
| 4-methoxytyraminium (CHEBI:192993) is conjugate acid of 4-methoxytyramine (CHEBI:89641) |
| IUPAC Name |
|---|
| 5-(2-aminoethyl)-2-methoxyphenol |
| Synonyms | Source |
|---|---|
| 2-(3-hydroxy-4-methoxyphenyl)ethylamine | ChEBI |
| 3-hydroxy-4-methoxyphenethylamine | ChemIDplus |
| 3-hydroxy-4-methoxyphenylethylamine | ChEBI |
| 4-O-methyldopamine | HMDB |
| 4-methoxy-3-hydroxyphenethylamine | ChEBI |
| 4-methoxy-3-hydroxyphenylethylamine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| FDB028818 | FooDB |
| HMDB0012162 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:3213-30-7 | ChemIDplus |
| Citations |
|---|