EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13NO2 |
| Net Charge | 0 |
| Average Mass | 167.208 |
| Monoisotopic Mass | 167.09463 |
| SMILES | COc1cc(CCN)ccc1O |
| InChI | InChI=1S/C9H13NO2/c1-12-9-6-7(4-5-10)2-3-8(9)11/h2-3,6,11H,4-5,10H2,1H3 |
| InChIKey | DIVQKHQLANKJQO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| blood (UBERON:0000178) | Article (Geigy Scientific Tables, 8th Rev edition, pp. 165-177. Edited by C. Lentner, West Cadwell, N.J.: Medical education Div., Ciba-Geigy Corp., Basel, Switzerland c1981-1992.) | ||
| urine (BTO:0001419) | PubMed (19309105) | ||
| cerebrospinal fluid (UBERON:0001359) | PubMed (4073504) | ||
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| Application: | biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methoxytyramine (CHEBI:1582) has functional parent dopamine (CHEBI:18243) |
| 3-methoxytyramine (CHEBI:1582) has role biomarker (CHEBI:59163) |
| 3-methoxytyramine (CHEBI:1582) has role human blood serum metabolite (CHEBI:85234) |
| 3-methoxytyramine (CHEBI:1582) has role human urinary metabolite (CHEBI:84087) |
| 3-methoxytyramine (CHEBI:1582) is a monomethoxybenzene (CHEBI:25235) |
| 3-methoxytyramine (CHEBI:1582) is a phenols (CHEBI:33853) |
| 3-methoxytyramine (CHEBI:1582) is a phenylethylamine (CHEBI:50048) |
| 3-methoxytyramine (CHEBI:1582) is a primary amino compound (CHEBI:50994) |
| 3-methoxytyramine (CHEBI:1582) is conjugate base of 3-methoxytyraminium (CHEBI:192089) |
| Incoming Relation(s) |
| 3-methoxytyramine sulfate (CHEBI:133708) has functional parent 3-methoxytyramine (CHEBI:1582) |
| 3-methoxytyraminium (CHEBI:192089) is conjugate acid of 3-methoxytyramine (CHEBI:1582) |
| IUPAC Name |
|---|
| 4-(2-aminoethyl)-2-methoxyphenol |
| Synonyms | Source |
|---|---|
| 2-(4-hydroxy-3-methoxyphenyl)ethylamine | ChEBI |
| 2-methoxy-4-(2-aminoethyl)phenol | ChEBI |
| 3-O-methyldopamine | HMDB |
| 3-methoxy-4-hydroxyphenethylamine | ChEBI |
| 3-methoxydopamine | ChEBI |
| 3-methoxy-p-tyramine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 1606 | ChemSpider |
| 3-Methoxytyramine | Wikipedia |
| C00042132 | KNApSAcK |
| C05587 | KEGG COMPOUND |
| FDB021876 | FooDB |
| HMDB0000022 | HMDB |
| Citations |
|---|