EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13N3O3 |
| Net Charge | 0 |
| Average Mass | 175.188 |
| Monoisotopic Mass | 175.09569 |
| SMILES | NC(=O)NCCCC(N)C(=O)O |
| InChI | InChI=1S/C6H13N3O3/c7-4(5(10)11)2-1-3-9-6(8)12/h4H,1-3,7H2,(H,10,11)(H3,8,9,12) |
| InChIKey | RHGKLRLOHDJJDR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia magna (ncbitaxon:35525) | - | Article (Mixtures of similarly acting compounds in Daphnia magna: From gene to metabolite and beyondTine Vandenbrouck, Oliver A.H. Jones, Nathalie Dom, Julian L. Griffin, Wim De CoenEnvironment International 36 (2010) 254-268) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| citrulline (CHEBI:18211) has role Daphnia magna metabolite (CHEBI:83056) |
| citrulline (CHEBI:18211) has role hapten (CHEBI:59174) |
| citrulline (CHEBI:18211) is a citrullines (CHEBI:23324) |
| citrulline (CHEBI:18211) is conjugate acid of citrullinate (CHEBI:66922) |
| Incoming Relation(s) |
| N-acetylcitrulline (CHEBI:49006) has functional parent citrulline (CHEBI:18211) |
| D-citrulline (CHEBI:49007) is a citrulline (CHEBI:18211) |
| L-citrulline (CHEBI:16349) is a citrulline (CHEBI:18211) |
| citrullinate (CHEBI:66922) is conjugate base of citrulline (CHEBI:18211) |
| IUPAC Names |
|---|
| 2-amino-5-(carbamoylamino)pentanoic acid |
| citrulline |
| N5-carbamoylornithine |
| Synonyms | Source |
|---|---|
| 2-Amino-5-uredovaleric acid | KEGG COMPOUND |
| Cit | IUPAC |
| citrulina | ChEBI |
| Citrullin | ChEBI |
| Citrulline | KEGG COMPOUND |
| dl-citrulline | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| Citrulline | Wikipedia |
| Citations |
|---|