EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15N3O4 |
| Net Charge | 0 |
| Average Mass | 217.225 |
| Monoisotopic Mass | 217.10626 |
| SMILES | CC(=O)NC(CCCNC(N)=O)C(=O)O |
| InChI | InChI=1S/C8H15N3O4/c1-5(12)11-6(7(13)14)3-2-4-10-8(9)15/h6H,2-4H2,1H3,(H,11,12)(H,13,14)(H3,9,10,15) |
| InChIKey | WMQMIOYQXNRROC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetylcitrulline (CHEBI:49006) has functional parent citrulline (CHEBI:18211) |
| N-acetylcitrulline (CHEBI:49006) is a N-acetyl-amino acid (CHEBI:21575) |
| N-acetylcitrulline (CHEBI:49006) is a monocarboxylic acid (CHEBI:25384) |
| N-acetylcitrulline (CHEBI:49006) is a ureas (CHEBI:47857) |
| Incoming Relation(s) |
| N-acetyl-L-citrulline (CHEBI:49002) is a N-acetylcitrulline (CHEBI:49006) |
| IUPAC Names |
|---|
| 2-acetamido-5-(carbamoylamino)pentanoic acid |
| N2-acetyl-N5-carbamoylornithine |
| Synonym | Source |
|---|---|
| 2-(acetylamino)-5-[(aminocarbonyl)amino]pentanoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2215792 | Reaxys |
| Citations |
|---|