EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12N3O3 |
| Net Charge | -1 |
| Average Mass | 174.180 |
| Monoisotopic Mass | 174.08841 |
| SMILES | NC(=O)NCCCC(N)C(=O)[O-] |
| InChI | InChI=1S/C6H13N3O3/c7-4(5(10)11)2-1-3-9-6(8)12/h4H,1-3,7H2,(H,10,11)(H3,8,9,12)/p-1 |
| InChIKey | RHGKLRLOHDJJDR-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| citrullinate (CHEBI:66922) is a α-amino-acid anion (CHEBI:33558) |
| citrullinate (CHEBI:66922) is conjugate base of citrulline (CHEBI:18211) |
| Incoming Relation(s) |
| citrulline (CHEBI:18211) is conjugate acid of citrullinate (CHEBI:66922) |
| IUPAC Name |
|---|
| 2-amino-5-(carbamoylamino)pentanoate |