EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13N3O3 |
| Net Charge | 0 |
| Average Mass | 175.188 |
| Monoisotopic Mass | 175.09569 |
| SMILES | NC(=O)NCCC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C6H13N3O3/c7-4(5(10)11)2-1-3-9-6(8)12/h4H,1-3,7H2,(H,10,11)(H3,8,9,12)/t4-/m1/s1 |
| InChIKey | RHGKLRLOHDJJDR-SCSAIBSYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-citrulline (CHEBI:49007) is a citrulline (CHEBI:18211) |
| D-citrulline (CHEBI:49007) is enantiomer of L-citrulline (CHEBI:16349) |
| Incoming Relation(s) |
| L-citrulline (CHEBI:16349) is enantiomer of D-citrulline (CHEBI:49007) |
| IUPAC Names |
|---|
| (2R)-2-amino-5-(carbamoylamino)pentanoic acid |
| N5-carbamoyl-D-ornithine |
| D-citrulline |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1725415 | Beilstein |