EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO3 |
| Net Charge | 0 |
| Average Mass | 131.131 |
| Monoisotopic Mass | 131.05824 |
| SMILES | O=C(O)[C@@H]1C[C@@H](O)CN1 |
| InChI | InChI=1S/C5H9NO3/c7-3-1-4(5(8)9)6-2-3/h3-4,6-7H,1-2H2,(H,8,9)/t3-,4+/m1/s1 |
| InChIKey | PMMYEEVYMWASQN-DMTCNVIQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | DOI (10.1074/jbc.M411109200) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-4-hydroxy-L-proline (CHEBI:18095) has role human metabolite (CHEBI:77746) |
| trans-4-hydroxy-L-proline (CHEBI:18095) has role mouse metabolite (CHEBI:75771) |
| trans-4-hydroxy-L-proline (CHEBI:18095) has role plant metabolite (CHEBI:76924) |
| trans-4-hydroxy-L-proline (CHEBI:18095) is a 4-hydroxyproline (CHEBI:20392) |
| trans-4-hydroxy-L-proline (CHEBI:18095) is tautomer of trans-4-hydroxy-L-proline zwitterion (CHEBI:58375) |
| Incoming Relation(s) |
| (R)-4-hydroxy-1-methyl-L-proline (CHEBI:134543) has functional parent trans-4-hydroxy-L-proline (CHEBI:18095) |
| L-hydroxyproline 2-naphthylamide (CHEBI:90449) has functional parent trans-4-hydroxy-L-proline (CHEBI:18095) |
| Gly-Hyp (CHEBI:138515) has functional parent trans-4-hydroxy-L-proline (CHEBI:18095) |
| Pro-Hyp (CHEBI:74767) has functional parent trans-4-hydroxy-L-proline (CHEBI:18095) |
| trans-4-hydroxy-L-proline residue (CHEBI:61965) is substituent group from trans-4-hydroxy-L-proline (CHEBI:18095) |
| trans-4-hydroxy-L-proline zwitterion (CHEBI:58375) is tautomer of trans-4-hydroxy-L-proline (CHEBI:18095) |
| IUPAC Name |
|---|
| (4R)-4-hydroxy-L-proline |
| Synonyms | Source |
|---|---|
| (2S,4R)-trans-4-hydroxyproline | ChEBI |
| (2S,4R)-4-hydroxy-2-pyrrolidinecarboxylic acid | ChEBI |
| Hydroxy-L-proline | ChemIDplus |
| Hydroxyproline | ChemIDplus |
| Hyp | ChEBI |
| Hypro | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4272 | DrugCentral |
| 4-HYDROXY-L-PROLINE | MetaCyc |
| C00001370 | KNApSAcK |
| C01157 | KEGG COMPOUND |
| C01157 | KEGG COMPOUND |
| HMDB0000725 | HMDB |
| HYP | PDBeChem |
| HYP_LEO2 | PDBeChem |
| HYP_LL | PDBeChem |
| HYP_LSN3 | PDBeChem |
| Citations |
|---|