EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO3 |
| Net Charge | 0 |
| Average Mass | 131.131 |
| Monoisotopic Mass | 131.05824 |
| SMILES | O=C([O-])[C@@H]1C[C@@H](O)C[NH2+]1 |
| InChI | InChI=1S/C5H9NO3/c7-3-1-4(5(8)9)6-2-3/h3-4,6-7H,1-2H2,(H,8,9)/t3-,4+/m1/s1 |
| InChIKey | PMMYEEVYMWASQN-DMTCNVIQSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-4-hydroxy-L-proline zwitterion (CHEBI:58375) is a L-α-amino acid zwitterion (CHEBI:59869) |
| trans-4-hydroxy-L-proline zwitterion (CHEBI:58375) is tautomer of trans-4-hydroxy-L-proline (CHEBI:18095) |
| Incoming Relation(s) |
| trans-4-hydroxy-L-proline betaine (CHEBI:85533) has functional parent trans-4-hydroxy-L-proline zwitterion (CHEBI:58375) |
| trans-4-hydroxy-L-proline (CHEBI:18095) is tautomer of trans-4-hydroxy-L-proline zwitterion (CHEBI:58375) |
| IUPAC Name |
|---|
| (2S,4R)-4-hydroxypyrrolidinium-2-carboxylate |
| Synonym | Source |
|---|---|
| hydroxyproline zwitterion | ChEBI |
| UniProt Name | Source |
|---|---|
| trans-4-hydroxy-L-proline | UniProt |