EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO3 |
| Net Charge | 0 |
| Average Mass | 145.158 |
| Monoisotopic Mass | 145.07389 |
| SMILES | CN1C[C@H](O)C[C@H]1C(=O)O |
| InChI | InChI=1S/C6H11NO3/c1-7-3-4(8)2-5(7)6(9)10/h4-5,8H,2-3H2,1H3,(H,9,10)/t4-,5+/m1/s1 |
| InChIKey | FMIPNAUMSPFTHK-UHNVWZDZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aglaia andamanica (IPNI:576960-1) | leaf (BTO:0000713) | PubMed (26427611) | |
| Arabidopsis thaliana (ncbitaxon:3702) | - | MetaboLights (MTBLS355) | |
| Dalbergia sympathetica (IPNI:490488-1) | leaf (BTO:0000713) | PubMed (16425210) | |
| Ipomoea carnea (ncbitaxon:89640) | leaf (BTO:0000713) | PubMed (12903959) | |
| Psittacanthus calyculatus (ncbitaxon:529590) | whole plant (BTO:0001461) | PubMed (22071447) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. anti-HIV-1 agent An anti-HIV agent that destroys or inhibits the replication of HIV-1, the more infective and more virulent of the two types of HIV virus. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-4-hydroxy-1-methyl-L-proline (CHEBI:134543) has functional parent trans-4-hydroxy-L-proline (CHEBI:18095) |
| (R)-4-hydroxy-1-methyl-L-proline (CHEBI:134543) has role anti-HIV-1 agent (CHEBI:64947) |
| (R)-4-hydroxy-1-methyl-L-proline (CHEBI:134543) has role plant metabolite (CHEBI:76924) |
| (R)-4-hydroxy-1-methyl-L-proline (CHEBI:134543) is a L-proline derivative (CHEBI:84186) |
| (R)-4-hydroxy-1-methyl-L-proline (CHEBI:134543) is a pyrrolidine alkaloid (CHEBI:26456) |
| Synonyms | Source |
|---|---|
| (4R)-4-hydroxy-1-methyl-L-proline | ChEBI |
| N-methyl-trans-4-hydroxy-L-proline | ChEBI |
| (R)-4-hydroxy-1-methylproline | ChEBI |
| (R)-4-hydroxy-N-methylproline | ChEBI |
| (R)-4-hydroxy-N-methyl-L-proline | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 9943383 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:472151 | Reaxys |
| Citations |
|---|