EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H7O4 |
| Net Charge | -1 |
| Average Mass | 203.173 |
| Monoisotopic Mass | 203.03498 |
| SMILES | O=C([O-])c1cc(O)c2ccccc2c1O |
| InChI | InChI=1S/C11H8O4/c12-9-5-8(11(14)15)10(13)7-4-2-1-3-6(7)9/h1-5,12-13H,(H,14,15)/p-1 |
| InChIKey | VOJUXHHACRXLTD-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (1091286) |
| Roles Classification |
|---|
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,4-dihydroxy-2-naphthoate (CHEBI:11173) has functional parent 2-naphthoate (CHEBI:36107) |
| 1,4-dihydroxy-2-naphthoate (CHEBI:11173) has role Escherichia coli metabolite (CHEBI:76971) |
| 1,4-dihydroxy-2-naphthoate (CHEBI:11173) is a hydroxy monocarboxylic acid anion (CHEBI:36059) |
| 1,4-dihydroxy-2-naphthoate (CHEBI:11173) is conjugate base of 1,4-dihydroxy-2-naphthoic acid (CHEBI:18094) |
| Incoming Relation(s) |
| 2-carbonyl-3-prenyl-1,4-dihydronaphthoquinone (CHEBI:230535) has functional parent 1,4-dihydroxy-2-naphthoate (CHEBI:11173) |
| 1,4-dihydroxy-2-naphthoic acid (CHEBI:18094) is conjugate acid of 1,4-dihydroxy-2-naphthoate (CHEBI:11173) |
| IUPAC Name |
|---|
| 1,4-dihydroxynaphthalene-2-carboxylate |
| UniProt Name | Source |
|---|---|
| 1,4-dihydroxy-2-naphthoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| DIHYDROXYNAPHTHOATE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21815550 | Reaxys |