EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H42N7O19P3S |
| Net Charge | 0 |
| Average Mass | 953.707 |
| Monoisotopic Mass | 953.14690 |
| SMILES | CC(C)(COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O)[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)c1cc(O)c2ccccc2c1O |
| InChI | InChI=1S/C32H42N7O19P3S/c1-32(2,26(44)29(45)35-8-7-21(41)34-9-10-62-31(46)18-11-19(40)16-5-3-4-6-17(16)23(18)42)13-55-61(52,53)58-60(50,51)54-12-20-25(57-59(47,48)49)24(43)30(56-20)39-15-38-22-27(33)36-14-37-28(22)39/h3-6,11,14-15,20,24-26,30,40,42-44H,7-10,12-13H2,1-2H3,(H,34,41)(H,35,45)(H,50,51)(H,52,53)(H2,33,36,37)(H2,47,48,49)/t20-,24-,25-,26+,30-/m1/s1 |
| InChIKey | PYTINLGPKDJURZ-HSJNEKGZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,4-dihydroxy-2-naphthoyl-CoA (CHEBI:52668) has functional parent 1,4-dihydroxy-2-naphthoic acid (CHEBI:18094) |
| 1,4-dihydroxy-2-naphthoyl-CoA (CHEBI:52668) has role Escherichia coli metabolite (CHEBI:76971) |
| 1,4-dihydroxy-2-naphthoyl-CoA (CHEBI:52668) is a acyl-CoA (CHEBI:17984) |
| 1,4-dihydroxy-2-naphthoyl-CoA (CHEBI:52668) is a naphthohydroquinone (CHEBI:51475) |
| 1,4-dihydroxy-2-naphthoyl-CoA (CHEBI:52668) is conjugate acid of 1,4-dihydroxy-2-naphthoyl-CoA(4−) (CHEBI:58897) |
| Incoming Relation(s) |
| 1,4-dihydroxy-2-naphthoyl-CoA(4−) (CHEBI:58897) is conjugate base of 1,4-dihydroxy-2-naphthoyl-CoA (CHEBI:52668) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-4-{[3-({2-[(1,4-dihydroxy-2-naphthoyl)sulfanyl]ethyl}amino)-3-oxopropyl]amino}-3-hydroxy-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| 1,4-Dihydroxy-2-naphthoyl-CoA | KEGG COMPOUND |
| 1,4-dihydroxy-2-naphthoyl-coenzyme A | ChEBI |
| DHNA-CoA | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| C15547 | KEGG COMPOUND |
| Citations |
|---|