EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O5 |
| Net Charge | 0 |
| Average Mass | 284.267 |
| Monoisotopic Mass | 284.06847 |
| SMILES | COc1ccc(-c2coc3cc(O)ccc3c2=O)c(O)c1 |
| InChI | InChI=1S/C16H12O5/c1-20-10-3-5-11(14(18)7-10)13-8-21-15-6-9(17)2-4-12(15)16(13)19/h2-8,17-18H,1H3 |
| InChIKey | XKHHKXCBFHUOHM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2'-hydroxyformononetin (CHEBI:17678) has functional parent formononetin (CHEBI:18088) |
| 2'-hydroxyformononetin (CHEBI:17678) has role anti-inflammatory agent (CHEBI:67079) |
| 2'-hydroxyformononetin (CHEBI:17678) is a 4'-methoxyisoflavones (CHEBI:133959) |
| 2'-hydroxyformononetin (CHEBI:17678) is a 7-hydroxyisoflavones (CHEBI:55465) |
| 2'-hydroxyformononetin (CHEBI:17678) is conjugate acid of 2'-hydroxyformononetin(1−) (CHEBI:77687) |
| Incoming Relation(s) |
| 2'-hydroxyformononetin(1−) (CHEBI:77687) is conjugate base of 2'-hydroxyformononetin (CHEBI:17678) |
| IUPAC Name |
|---|
| 7-hydroxy-3-(2-hydroxy-4-methoxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 2'-Hydroformononetin | KEGG COMPOUND |
| 2'-Hydroxyformononetin | KEGG COMPOUND |
| Xenognosin B | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| 2-HYDROXYFORMONONETIN | MetaCyc |
| C00000257 | KNApSAcK |
| C02920 | KEGG COMPOUND |
| HMDB0031720 | HMDB |
| LMPK12050081 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1292487 | Reaxys |
| CAS:1890-99-9 | KEGG COMPOUND |
| Citations |
|---|