EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H24O12 |
| Net Charge | 0 |
| Average Mass | 516.455 |
| Monoisotopic Mass | 516.12678 |
| SMILES | COc1ccc(-c2coc3cc(O[C@@H]4O[C@H](COC(=O)CC(=O)O)[C@@H](O)[C@H](O)[C@H]4O)ccc3c2=O)cc1 |
| InChI | InChI=1S/C25H24O12/c1-33-13-4-2-12(3-5-13)16-10-34-17-8-14(6-7-15(17)21(16)29)36-25-24(32)23(31)22(30)18(37-25)11-35-20(28)9-19(26)27/h2-8,10,18,22-25,30-32H,9,11H2,1H3,(H,26,27)/t18-,22-,23+,24-,25-/m1/s1 |
| InChIKey | RDTAGQKYPGLCBK-GOZZSVHWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Medicago sativa (ncbitaxon:3879) | - | PubMed (12232319) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| formononetin 7-O-glucoside-6''-O-malonate (CHEBI:80389) has functional parent formononetin (CHEBI:18088) |
| formononetin 7-O-glucoside-6''-O-malonate (CHEBI:80389) has role plant metabolite (CHEBI:76924) |
| formononetin 7-O-glucoside-6''-O-malonate (CHEBI:80389) is a 4'-methoxyisoflavones (CHEBI:133959) |
| formononetin 7-O-glucoside-6''-O-malonate (CHEBI:80389) is a glycosyloxyisoflavone (CHEBI:74630) |
| formononetin 7-O-glucoside-6''-O-malonate (CHEBI:80389) is a malonate ester (CHEBI:38083) |
| formononetin 7-O-glucoside-6''-O-malonate (CHEBI:80389) is a monosaccharide derivative (CHEBI:63367) |
| IUPAC Names |
|---|
| 3-(4-methoxyphenyl)-4-oxo-4H-1-benzopyran-7-yl 6-O-(carboxyacetyl)-β-D-glucopyranoside |
| 7-hydroxy-4'-methoxyisoflavone 7-O-β-(6'-O-malonylglucoside) |
| Manual Xrefs | Databases |
|---|---|
| C16222 | KEGG COMPOUND |
| C00010083 | KNApSAcK |
| LMPK12050020 | LIPID MAPS |
| HMDB0029493 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7156324 | Reaxys |
| Citations |
|---|