EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H21N3O6 |
| Net Charge | 0 |
| Average Mass | 303.315 |
| Monoisotopic Mass | 303.14304 |
| SMILES | N[C@@H](CCN[C@@H](CCN1CC[C@H]1C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H21N3O6/c13-7(10(16)17)1-4-14-8(11(18)19)2-5-15-6-3-9(15)12(20)21/h7-9,14H,1-6,13H2,(H,16,17)(H,18,19)(H,20,21)/t7-,8-,9-/m0/s1 |
| InChIKey | KRGPXXHMOXVMMM-CIUDSAMLSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. phytosiderophore Any of low-molecular-mass iron(III)-chelating compounds produced by plants for the purpose of the transport and sequestration of iron. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. phytosiderophore Any of low-molecular-mass iron(III)-chelating compounds produced by plants for the purpose of the transport and sequestration of iron. |
| Application: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S,S,S)-nicotianamine (CHEBI:17721) has functional parent (S)-azetidine-2-carboxylic acid (CHEBI:6198) |
| (S,S,S)-nicotianamine (CHEBI:17721) has role chelator (CHEBI:38161) |
| (S,S,S)-nicotianamine (CHEBI:17721) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| (S,S,S)-nicotianamine (CHEBI:17721) has role plant metabolite (CHEBI:76924) |
| (S,S,S)-nicotianamine (CHEBI:17721) is a nicotianamine (CHEBI:25520) |
| (S,S,S)-nicotianamine (CHEBI:17721) is conjugate acid of (S,S,S)-nicotianamine monoanion (CHEBI:62921) |
| (S,S,S)-nicotianamine (CHEBI:17721) is enantiomer of (R,R,R)-nicotianamine (CHEBI:38113) |
| (S,S,S)-nicotianamine (CHEBI:17721) is tautomer of (S,S,S)-nicotianamine trizwitterion (CHEBI:58249) |
| Incoming Relation(s) |
| (S,S,S)-nicotianamine monoanion (CHEBI:62921) is conjugate base of (S,S,S)-nicotianamine (CHEBI:17721) |
| (R,R,R)-nicotianamine (CHEBI:38113) is enantiomer of (S,S,S)-nicotianamine (CHEBI:17721) |
| (S,S,S)-nicotianamine trizwitterion (CHEBI:58249) is tautomer of (S,S,S)-nicotianamine (CHEBI:17721) |
| IUPAC Name |
|---|
| (2S)-1-[(3S)-3-{[(3S)-3-amino-3-carboxypropyl]amino}-3-carboxypropyl]azetidine-2-carboxylic acid |
| Synonym | Source |
|---|---|
| Nicotianamine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00016287 | KNApSAcK |
| C05324 | KEGG COMPOUND |
| CPD-463 | MetaCyc |
| Nicotianamine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8163098 | Reaxys |
| CAS:34441-14-0 | KEGG COMPOUND |
| CAS:34441-14-0 | ChemIDplus |
| Citations |
|---|