EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7NO2 |
| Net Charge | 0 |
| Average Mass | 101.105 |
| Monoisotopic Mass | 101.04768 |
| SMILES | [H][C@@]1(C(=O)O)CCN1 |
| InChI | InChI=1S/C4H7NO2/c6-4(7)3-1-2-5-3/h3,5H,1-2H2,(H,6,7)/t3-/m0/s1 |
| InChIKey | IADUEWIQBXOCDZ-VKHMYHEASA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-azetidine-2-carboxylic acid (CHEBI:6198) is a azetidine-2-carboxylic acid (CHEBI:38108) |
| (S)-azetidine-2-carboxylic acid (CHEBI:6198) is enantiomer of (R)-azetidine-2-carboxylic acid (CHEBI:38109) |
| (S)-azetidine-2-carboxylic acid (CHEBI:6198) is tautomer of (S)-azetidine-2-carboxylate zwitterion (CHEBI:231534) |
| Incoming Relation(s) |
| (S,R,R)-nicotianamine (CHEBI:38115) has functional parent (S)-azetidine-2-carboxylic acid (CHEBI:6198) |
| (S,S,S)-nicotianamine (CHEBI:17721) has functional parent (S)-azetidine-2-carboxylic acid (CHEBI:6198) |
| (R)-azetidine-2-carboxylic acid (CHEBI:38109) is enantiomer of (S)-azetidine-2-carboxylic acid (CHEBI:6198) |
| (S)-azetidine-2-carboxylate zwitterion (CHEBI:231534) is tautomer of (S)-azetidine-2-carboxylic acid (CHEBI:6198) |
| IUPAC Name |
|---|
| (2S)-azetidine-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| Azetidyl-2-carboxylic acid | KEGG COMPOUND |
| (S)-2-azetidinecarboxylic acid | ChemIDplus |
| (S)-azetidine-2-carboxylic acid | ChemIDplus |
| L-Azetidine 2-carboxylic acid | KEGG COMPOUND |
| (S)-(-)-Azetidine-2-carboxylic acid | KEGG COMPOUND |
| Citations |
|---|