EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H21N3O6 |
| Net Charge | 0 |
| Average Mass | 303.315 |
| Monoisotopic Mass | 303.14304 |
| SMILES | N[C@H](CCN[C@H](CCN1CC[C@@H]1C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H21N3O6/c13-7(10(16)17)1-4-14-8(11(18)19)2-5-15-6-3-9(15)12(20)21/h7-9,14H,1-6,13H2,(H,16,17)(H,18,19)(H,20,21)/t7-,8-,9-/m1/s1 |
| InChIKey | KRGPXXHMOXVMMM-IWSPIJDZSA-N |
| Roles Classification |
|---|
| Chemical Roles: | phytosiderophore Any of low-molecular-mass iron(III)-chelating compounds produced by plants for the purpose of the transport and sequestration of iron. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | phytosiderophore Any of low-molecular-mass iron(III)-chelating compounds produced by plants for the purpose of the transport and sequestration of iron. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R,R,R)-nicotianamine (CHEBI:38113) has functional parent (R)-azetidine-2-carboxylic acid (CHEBI:38109) |
| (R,R,R)-nicotianamine (CHEBI:38113) is a nicotianamine (CHEBI:25520) |
| (R,R,R)-nicotianamine (CHEBI:38113) is enantiomer of (S,S,S)-nicotianamine (CHEBI:17721) |
| Incoming Relation(s) |
| (S,S,S)-nicotianamine (CHEBI:17721) is enantiomer of (R,R,R)-nicotianamine (CHEBI:38113) |
| IUPAC Name |
|---|
| (2R)-1-[(3R)-3-{[(3R)-3-amino-3-carboxypropyl]amino}-3-carboxypropyl]azetidine-2-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6575168 | Beilstein |