EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H21N3O6 |
| Net Charge | 0 |
| Average Mass | 303.315 |
| Monoisotopic Mass | 303.14304 |
| SMILES | [NH3+][C@@H](CC[NH2+][C@@H](CC[NH+]1CC[C@H]1C(=O)[O-])C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C12H21N3O6/c13-7(10(16)17)1-4-14-8(11(18)19)2-5-15-6-3-9(15)12(20)21/h7-9,14H,1-6,13H2,(H,16,17)(H,18,19)(H,20,21)/t7-,8-,9-/m0/s1 |
| InChIKey | KRGPXXHMOXVMMM-CIUDSAMLSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S,S,S)-nicotianamine trizwitterion (CHEBI:58249) has role plant metabolite (CHEBI:76924) |
| (S,S,S)-nicotianamine trizwitterion (CHEBI:58249) is a amino-acid zwitterion (CHEBI:35238) |
| (S,S,S)-nicotianamine trizwitterion (CHEBI:58249) is tautomer of (S,S,S)-nicotianamine (CHEBI:17721) |
| Incoming Relation(s) |
| (S,S,S)-nicotianamine (CHEBI:17721) is tautomer of (S,S,S)-nicotianamine trizwitterion (CHEBI:58249) |
| IUPAC Name |
|---|
| (2S)-1-[(3S)-3-{[(3S)-3-azaniumyl-3-carboxylatopropyl]azaniumyl}-3-carboxylatopropyl]azetidinium-2-carboxylate |
| Synonyms | Source |
|---|---|
| (2S)-1-[(3S)-3-{[(3S)-3-ammonio-3-carboxylatopropyl]ammonio}-3-carboxylatopropyl]azetidinium-2-carboxylate | IUPAC |
| (S,S,S)-nicotianamine zwitterion | ChEBI |
| UniProt Name | Source |
|---|---|
| nicotianamine | UniProt |