EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12N2O4S2 |
| Net Charge | 0 |
| Average Mass | 240.306 |
| Monoisotopic Mass | 240.02385 |
| SMILES | [NH3+]C(CSSCC([NH3+])C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C6H12N2O4S2/c7-3(5(9)10)1-13-14-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12) |
| InChIKey | LEVWYRKDKASIDU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cystine zwitterion (CHEBI:35492) has role human metabolite (CHEBI:77746) |
| cystine zwitterion (CHEBI:35492) has role mouse metabolite (CHEBI:75771) |
| cystine zwitterion (CHEBI:35492) is a amino-acid zwitterion (CHEBI:35238) |
| cystine zwitterion (CHEBI:35492) is tautomer of cystine (CHEBI:17376) |
| Incoming Relation(s) |
| D-cystine zwitterion (CHEBI:145813) is a cystine zwitterion (CHEBI:35492) |
| L-cystine zwitterion (CHEBI:35491) is a cystine zwitterion (CHEBI:35492) |
| cystine (CHEBI:17376) is tautomer of cystine zwitterion (CHEBI:35492) |
| IUPAC Name |
|---|
| 3,3'-disulfanediylbis(2-ammoniopropanoate) |
| Synonym | Source |
|---|---|
| 3,3'-dithiobis(2-ammoniopropanoate) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:51007 | Gmelin |