EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO2S |
| Net Charge | 0 |
| Average Mass | 149.215 |
| Monoisotopic Mass | 149.05105 |
| SMILES | CSCCC(N)C(=O)O |
| InChI | InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8) |
| InChIKey | FFEARJCKVFRZRR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (2543976) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | DOI (10.1016/0003-9861(62)90112-1) | |
| Arabidopsis thaliana (ncbitaxon:3702) | - | PubMed (15834012) | |
| Daphnia magna (ncbitaxon:35525) | - | Article (Mixtures of similarly acting compounds in Daphnia magna: From gene to metabolite and beyondTine Vandenbrouck, Oliver A.H. Jones, Nathalie Dom, Julian L. Griffin, Wim De CoenEnvironment International 36 (2010) 254-268) | |
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) |
| Roles Classification |
|---|
| ChEBI Ontology |
|---|
| IUPAC Name |
|---|
| methionine |
| Synonyms | Source |
|---|---|
| Methionine | KEGG COMPOUND |
| 2-Amino-4-(methylthio)butyric acid | KEGG COMPOUND |
| 2-amino-4-(methylthio)butanoic acid | JCBN |
| Methionin | ChEBI |
| 2-amino-4-(methylsulfanyl)butanoic acid | IUPAC |
| α-amino-γ-methylmercaptobutyric acid | NIST Chemistry WebBook |
| Citations |
|---|