EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12N2O2S |
| Net Charge | 0 |
| Average Mass | 164.230 |
| Monoisotopic Mass | 164.06195 |
| SMILES | CSCCC(N)C(=O)NO |
| InChI | InChI=1S/C5H12N2O2S/c1-10-3-2-4(6)5(8)7-9/h4,9H,2-3,6H2,1H3,(H,7,8) |
| InChIKey | HUPYBBFSQOFVSZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 6.1.1.* (ligases forming aminoacyl tRNA and related compounds) inhibitor An EC 6.1.* (C‒O bond-forming ligase) inhibitor that interferes with the action of any ligase forming aminoacyl tRNA and related compounds (EC 6.1.1.*). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methioninehydroxamic acid (CHEBI:75415) has functional parent methionine (CHEBI:16811) |
| methioninehydroxamic acid (CHEBI:75415) has role EC 6.1.1.* (ligases forming aminoacyl tRNA and related compounds) inhibitor (CHEBI:75416) |
| methioninehydroxamic acid (CHEBI:75415) is a hydroxamic acid (CHEBI:24650) |
| methioninehydroxamic acid (CHEBI:75415) is a methionine derivative (CHEBI:25230) |
| IUPAC Name |
|---|
| N-hydroxymethioninamide |
| Synonyms | Source |
|---|---|
| dl-methioninehydroxamic acid | ChEBI |
| methionine hydroxamate | ChEBI |
| (±)-methioninehydroxamic acid | ChEBI |
| DL-methionine hydroxamate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2411852 | Reaxys |