EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16867 - D-methionine
| Formula | C5H11NO2S |
| Net Charge | 0 |
| Average Mass | 149.215 |
| Monoisotopic Mass | 149.05105 |
| SMILES | CSCC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m1/s1 |
| InChIKey | FFEARJCKVFRZRR-SCSAIBSYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (15375647) | |
| Escherichia coli (ncbitaxon:562) | |||
| - | PubMed (318639) | ||
| - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-methionine (CHEBI:16867) is a D-α-amino acid (CHEBI:16733) |
| D-methionine (CHEBI:16867) is a methionine (CHEBI:16811) |
| D-methionine (CHEBI:16867) is conjugate acid of D-methioninate (CHEBI:32637) |
| D-methionine (CHEBI:16867) is conjugate base of D-methioninium (CHEBI:32638) |
| D-methionine (CHEBI:16867) is enantiomer of L-methionine (CHEBI:16643) |
| D-methionine (CHEBI:16867) is tautomer of D-methionine zwitterion (CHEBI:57932) |
| Incoming Relation(s) |
| (R)-5-[2-(methylthio)ethyl]hydantoin (CHEBI:137150) has functional parent D-methionine (CHEBI:16867) |
| D-methionine derivative (CHEBI:84122) has functional parent D-methionine (CHEBI:16867) |
| D-methioninium (CHEBI:32638) is conjugate acid of D-methionine (CHEBI:16867) |
| D-methioninate (CHEBI:32637) is conjugate base of D-methionine (CHEBI:16867) |
| L-methionine (CHEBI:16643) is enantiomer of D-methionine (CHEBI:16867) |
| D-methionine residue (CHEBI:29984) is substituent group from D-methionine (CHEBI:16867) |
| D-methionino group (CHEBI:32641) is substituent group from D-methionine (CHEBI:16867) |
| D-methionyl group (CHEBI:32640) is substituent group from D-methionine (CHEBI:16867) |
| D-methionine zwitterion (CHEBI:57932) is tautomer of D-methionine (CHEBI:16867) |
| IUPAC Name |
|---|
| D-methionine |
| Synonyms | Source |
|---|---|
| D-Methionine | KEGG COMPOUND |
| D-2-Amino-4-(methylthio)butyric acid | KEGG COMPOUND |
| (2R)-2-amino-4-(methylsulfanyl)butanoic acid | IUPAC |
| D-METHIONINE | PDBeChem |
| (R)-methionine | ChemIDplus |
| (R)-2-amino-4-(methylthio)butanoic acid | JCBN |
| Citations |
|---|