EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16619 - (2-trans,6-trans)-farnesol
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CO |
| InChI | InChI=1S/C15H26O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11,16H,5-6,8,10,12H2,1-4H3/b14-9+,15-11+ |
| InChIKey | CRDAMVZIKSXKFV-YFVJMOTDSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2-trans,6-trans)-farnesol (CHEBI:16619) has parent hydride (6E,10E)-2,6,10-trimethyldodeca-2,6,10-triene (CHEBI:42362) |
| (2-trans,6-trans)-farnesol (CHEBI:16619) has role plant metabolite (CHEBI:76924) |
| (2-trans,6-trans)-farnesol (CHEBI:16619) is a farnesol (CHEBI:28600) |
| Incoming Relation(s) |
| (2E,6E,10E)-ω-hydroxyfarnesol (CHEBI:83951) has functional parent (2-trans,6-trans)-farnesol (CHEBI:16619) |
| (2E,6E)-farnesyl monophosphate (CHEBI:90236) has functional parent (2-trans,6-trans)-farnesol (CHEBI:16619) |
| yanuthone K (CHEBI:133035) has functional parent (2-trans,6-trans)-farnesol (CHEBI:16619) |
| yanuthone X2 (CHEBI:133037) has functional parent (2-trans,6-trans)-farnesol (CHEBI:16619) |
| IUPAC Name |
|---|
| (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-ol |
| Synonyms | Source |
|---|---|
| 2-trans,6-trans-Farnesol | KEGG COMPOUND |
| (2-trans,6-trans)-3,7,11-trimethyldodeca-2,6,10-trien-1-ol | IUPAC |
| (2E,6E)-farnesol | NIST Chemistry WebBook |
| trans-farnesol | ChemIDplus |
| (E,E)-farnesol | NIST Chemistry WebBook |
| all-trans-farnesol | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| (2E,6E)-farnesol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C01126 | KEGG COMPOUND |
| LMPR0103010001 | LIPID MAPS |
| C00003132 | KNApSAcK |
| 2-TRANS6-TRANS-FARNESOL | MetaCyc |
| HMDB0004305 | HMDB |
| 2113 | BPDB |