EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | [H]C(CO)=C(C)CCC([H])=C(C)CCC=C(C)C |
| InChI | InChI=1S/C15H26O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11,16H,5-6,8,10,12H2,1-4H3 |
| InChIKey | CRDAMVZIKSXKFV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Candida albicans (ncbitaxon:5476) | - | PubMed (23902158) | |
| Centella asiatica (ncbitaxon:48106) | - | MetaboLights (MTBLS175) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| farnesol (CHEBI:28600) has role antimicrobial agent (CHEBI:33281) |
| farnesol (CHEBI:28600) has role fungal metabolite (CHEBI:76946) |
| farnesol (CHEBI:28600) has role plant metabolite (CHEBI:76924) |
| farnesol (CHEBI:28600) is a farnesane sesquiterpenoid (CHEBI:36757) |
| farnesol (CHEBI:28600) is a polyprenol (CHEBI:26199) |
| farnesol (CHEBI:28600) is a primary alcohol (CHEBI:15734) |
| Incoming Relation(s) |
| (2-cis,6-cis)-farnesol (CHEBI:42680) is a farnesol (CHEBI:28600) |
| (2-cis,6-trans)-farnesol (CHEBI:16774) is a farnesol (CHEBI:28600) |
| (2-trans,6-cis)-farnesol (CHEBI:35966) is a farnesol (CHEBI:28600) |
| (2-trans,6-trans)-farnesol (CHEBI:16619) is a farnesol (CHEBI:28600) |
| IUPAC Name |
|---|
| 3,7,11-trimethyldodeca-2,6,10-trien-1-ol |
| Synonyms | Source |
|---|---|
| 3,7,11-trimethyl-2,6,10-dodecatrien-1-ol | ChemIDplus |
| 3,7,11-trimethyl-2,6,10-dodecatrienol | NIST Chemistry WebBook |
| Farnesol | KEGG COMPOUND |
| farnesyl alcohol | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| farnesol | UniProt |
| Citations |
|---|