EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O4 |
| Net Charge | 0 |
| Average Mass | 360.494 |
| Monoisotopic Mass | 360.23006 |
| SMILES | COC1=CC(=O)[C@]2(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)O[C@@H]2[C@@H]1O |
| InChI | InChI=1S/C22H32O4/c1-15(2)8-6-9-16(3)10-7-11-17(4)12-13-22-19(23)14-18(25-5)20(24)21(22)26-22/h8,10,12,14,20-21,24H,6-7,9,11,13H2,1-5H3/b16-10+,17-12+/t20-,21-,22+/m1/s1 |
| InChIKey | URXBIEAAUGXNIJ-ITGDQCKOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger ATCC 1015 (ncbitaxon:380704) | - | PubMed (25293978) | Strain: KB1001 |
| Roles Classification |
|---|
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| yanuthone X2 (CHEBI:133037) has functional parent (2-trans,6-trans)-farnesol (CHEBI:16619) |
| yanuthone X2 (CHEBI:133037) has role Aspergillus metabolite (CHEBI:76956) |
| yanuthone X2 (CHEBI:133037) has role antifungal agent (CHEBI:35718) |
| yanuthone X2 (CHEBI:133037) is a class II yanuthone (CHEBI:133081) |
| yanuthone X2 (CHEBI:133037) is a enol ether (CHEBI:47985) |
| yanuthone X2 (CHEBI:133037) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| yanuthone X1 (CHEBI:133095) has functional parent yanuthone X2 (CHEBI:133037) |
| IUPAC Name |
|---|
| (1R,5S,6R)-5-hydroxy-4-methoxy-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| Synonyms | Source |
|---|---|
| yanuthone X2 | ChEBI |
| yanuthone-X2 | ChEBI |
| yanuthone-X2 | ChEBI |
| Citations |
|---|