EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O4 |
| Net Charge | 0 |
| Average Mass | 360.494 |
| Monoisotopic Mass | 360.23006 |
| SMILES | COC1=CC(=O)[C@]2(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)O[C@@H]2[C@@H]1O |
| InChI | InChI=1S/C22H32O4/c1-15(2)8-6-9-16(3)10-7-11-17(4)12-13-22-19(23)14-18(25-5)20(24)21(22)26-22/h8,10,12,14,20-21,24H,6-7,9,11,13H2,1-5H3/b16-10+,17-12+/t20-,21-,22+/m1/s1 |
| InChIKey | URXBIEAAUGXNIJ-ITGDQCKOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger ATCC 1015 (ncbitaxon:380704) | - | PubMed (25293978) | Strain: KB1001 |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| yanuthone X2 (CHEBI:133037) has functional parent (2-trans,6-trans)-farnesol (CHEBI:16619) |
| yanuthone X2 (CHEBI:133037) has role Aspergillus metabolite (CHEBI:76956) |
| yanuthone X2 (CHEBI:133037) has role antifungal agent (CHEBI:35718) |
| yanuthone X2 (CHEBI:133037) is a class II yanuthone (CHEBI:133081) |
| yanuthone X2 (CHEBI:133037) is a enol ether (CHEBI:47985) |
| yanuthone X2 (CHEBI:133037) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| yanuthone X1 (CHEBI:133095) has functional parent yanuthone X2 (CHEBI:133037) |
| IUPAC Name |
|---|
| (1R,5S,6R)-5-hydroxy-4-methoxy-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| Synonyms | Source |
|---|---|
| yanuthone X2 | ChEBI |
| yanuthone-X2 | ChEBI |
| yanuthone-X2 | ChEBI |
| Citations |
|---|