EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H27O4P |
| Net Charge | 0 |
| Average Mass | 302.351 |
| Monoisotopic Mass | 302.16470 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/COP(=O)(O)O |
| InChI | InChI=1S/C15H27O4P/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-19-20(16,17)18/h7,9,11H,5-6,8,10,12H2,1-4H3,(H2,16,17,18)/b14-9+,15-11+ |
| InChIKey | ALEWCKXBHSDCCT-YFVJMOTDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | PubMed (21395888) | |
| Rattus norvegicus (ncbitaxon:10116) | - | PubMed (9606952) |
| Roles Classification |
|---|
| Biological Roles: | PPARbeta/delta agonist A PPAR modulator which activates the peroxisome proliferator-activated receptor-β/δ. rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). PPARalpha agonist A PPAR modulator which activates the peroxisome proliferator-activated receptor-α. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E,6E)-farnesyl monophosphate (CHEBI:90236) has functional parent (2-trans,6-trans)-farnesol (CHEBI:16619) |
| (2E,6E)-farnesyl monophosphate (CHEBI:90236) has role plant metabolite (CHEBI:76924) |
| (2E,6E)-farnesyl monophosphate (CHEBI:90236) has role PPARα agonist (CHEBI:70782) |
| (2E,6E)-farnesyl monophosphate (CHEBI:90236) has role PPARβ/δ agonist (CHEBI:73730) |
| (2E,6E)-farnesyl monophosphate (CHEBI:90236) has role rat metabolite (CHEBI:86264) |
| (2E,6E)-farnesyl monophosphate (CHEBI:90236) is a farnesyl phosphate (CHEBI:24018) |
| (2E,6E)-farnesyl monophosphate (CHEBI:90236) is conjugate acid of (2E,6E)-farnesyl monophosphate(2−) (CHEBI:88226) |
| Incoming Relation(s) |
| (2E,6E)-farnesyl monophosphate(2−) (CHEBI:88226) is conjugate base of (2E,6E)-farnesyl monophosphate (CHEBI:90236) |
| IUPAC Name |
|---|
| (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl dihydrogen phosphate |
| Synonyms | Source |
|---|---|
| (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl monophosphate | ChEBI |
| (2E,6E)-farnesol monophosphate | ChEBI |
| (2E,6E)-farnesyl phosphate | ChEBI |
| 2-trans,6-trans-farnesyl monophosphate | ChEBI |
| Farnesyl monophosphate | ChemIDplus |
| Farnesyl phosphate | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2736879 | Reaxys |
| CAS:15416-91-8 | ChemIDplus |
| Citations |
|---|