EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16154 - L-gulonic acid
| Formula | C6H12O7 |
| Net Charge | 0 |
| Average Mass | 196.155 |
| Monoisotopic Mass | 196.05830 |
| SMILES | O=C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[A1121h]/1/ |
| InChI | InChI=1S/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/t2-,3+,4-,5-/m0/s1 |
| InChIKey | RGHNJXZEOKUKBD-QTBDOELSSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-gulonic acid (CHEBI:16154) is a gulonic acid (CHEBI:24462) |
| L-gulonic acid (CHEBI:16154) is conjugate acid of L-gulonate (CHEBI:13115) |
| L-gulonic acid (CHEBI:16154) is enantiomer of D-gulonic acid (CHEBI:87753) |
| Incoming Relation(s) |
| L-gulono-1,4-lactone (CHEBI:17587) has functional parent L-gulonic acid (CHEBI:16154) |
| 2-dehydro-L-idonic acid (CHEBI:19543) has functional parent L-gulonic acid (CHEBI:16154) |
| 3-dehydro-L-gulonic acid (CHEBI:16142) has functional parent L-gulonic acid (CHEBI:16154) |
| 6-deoxy-6-[(2R,3R,4R)-3,4-dihydroxy-2-(hydroxymethyl)pyrrolidin-1-yl]-L-gulonic acid (CHEBI:46440) has functional parent L-gulonic acid (CHEBI:16154) |
| L-gulonate (CHEBI:13115) is conjugate base of L-gulonic acid (CHEBI:16154) |
| D-gulonic acid (CHEBI:87753) is enantiomer of L-gulonic acid (CHEBI:16154) |
| IUPAC Name |
|---|
| L-gulonic acid |
| Synonyms | Source |
|---|---|
| L-Gulonic acid | KEGG COMPOUND |
| Gulonic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00800 | KEGG COMPOUND |
| HMDB0003290 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:526-97-6 | KEGG COMPOUND |
| Citations |
|---|