EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16142 - 3-dehydro-L-gulonic acid
| Formula | C6H10O7 |
| Net Charge | 0 |
| Average Mass | 194.139 |
| Monoisotopic Mass | 194.04265 |
| SMILES | O=C(O)[C@@H](O)C(=O)[C@H](O)[C@@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[A1O21h]/1/ |
| InChI | InChI=1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-3,5,7-9,11H,1H2,(H,12,13)/t2-,3+,5-/m0/s1 |
| InChIKey | WTAHRPBPWHCMHW-LWKDLAHASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-dehydro-L-gulonic acid (CHEBI:16142) has functional parent L-gulonic acid (CHEBI:16154) |
| 3-dehydro-L-gulonic acid (CHEBI:16142) has role Escherichia coli metabolite (CHEBI:76971) |
| 3-dehydro-L-gulonic acid (CHEBI:16142) is a hexonic acid (CHEBI:33752) |
| 3-dehydro-L-gulonic acid (CHEBI:16142) is a ketoaldonic acid (CHEBI:24963) |
| 3-dehydro-L-gulonic acid (CHEBI:16142) is conjugate acid of 3-dehydro-L-gulonate (CHEBI:57655) |
| Incoming Relation(s) |
| 3-dehydro-L-gulonic acid 6-phosphate (CHEBI:49039) has functional parent 3-dehydro-L-gulonic acid (CHEBI:16142) |
| 3-dehydro-L-gulonate (CHEBI:57655) is conjugate base of 3-dehydro-L-gulonic acid (CHEBI:16142) |
| IUPAC Name |
|---|
| L-xylo-hex-3-ulosonic acid |
| Synonyms | Source |
|---|---|
| 3-Dehydro-L-gulonate | KEGG COMPOUND |
| 3-dehydro-L-gulonate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00618 | KEGG COMPOUND |