EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O7 |
| Net Charge | 0 |
| Average Mass | 194.139 |
| Monoisotopic Mass | 194.04265 |
| SMILES | O=C(O)C(=O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[AO121h]/1/ |
| InChI | InChI=1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-4,7-10H,1H2,(H,12,13)/t2-,3+,4-/m0/s1 |
| InChIKey | VBUYCZFBVCCYFD-NUNKFHFFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-dehydro-L-idonic acid (CHEBI:19543) has functional parent L-gulonic acid (CHEBI:16154) |
| 2-dehydro-L-idonic acid (CHEBI:19543) has functional parent L-idonic acid (CHEBI:21336) |
| 2-dehydro-L-idonic acid (CHEBI:19543) is a ketoaldonic acid (CHEBI:24963) |
| 2-dehydro-L-idonic acid (CHEBI:19543) is conjugate acid of 2-dehydro-L-idonate (CHEBI:36602) |
| Incoming Relation(s) |
| 2-dehydro-L-idonate (CHEBI:36602) is conjugate base of 2-dehydro-L-idonic acid (CHEBI:19543) |
| IUPAC Name |
|---|
| L-sorbosonic acid |
| Synonyms | Source |
|---|---|
| L-xylo-hex-2-ulosonic acid | IUPAC |
| 2-Keto-L-gulonic acid | ChemIDplus |
| 2-Oxo-l-gulonic acid | ChemIDplus |
| 3-keto-L-Gulonic acid | ChemIDplus |
| L-Xylohexulosonic acid | ChemIDplus |
| L-xylo-2-Hexulosonic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1726798 | Beilstein |
| CAS:526-98-7 | ChemIDplus |
| CAS:526-98-7 | KEGG COMPOUND |