EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8ClNO2 |
| Net Charge | 0 |
| Average Mass | 149.577 |
| Monoisotopic Mass | 149.02436 |
| SMILES | C=C(Cl)C[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C5H8ClNO2/c1-3(6)2-4(7)5(8)9/h4H,1-2,7H2,(H,8,9)/t4-/m0/s1 |
| InChIKey | WLZNZXQYFWOBGU-BYPYZUCNSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-2-amino-4-chloropent-4-enoic acid zwitterion (CHEBI:57555) is a L-α-amino acid zwitterion (CHEBI:59869) |
| L-2-amino-4-chloropent-4-enoic acid zwitterion (CHEBI:57555) is tautomer of L-2-amino-4-chloropent-4-enoic acid (CHEBI:15885) |
| Incoming Relation(s) |
| L-2-amino-4-chloropent-4-enoic acid (CHEBI:15885) is tautomer of L-2-amino-4-chloropent-4-enoic acid zwitterion (CHEBI:57555) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-4-chloropent-4-enoate |
| Synonyms | Source |
|---|---|
| (2S)-2-azaniumyl-4-chloropent-4-enoate | ChEBI |
| L-2-ammonio-4-chloropent-4-enoate | ChEBI |
| UniProt Name | Source |
|---|---|
| L-2-amino-4-chloropent-4-enoate | UniProt |