EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7ClNO2 |
| Net Charge | -1 |
| Average Mass | 148.569 |
| Monoisotopic Mass | 148.01708 |
| SMILES | C=C(Cl)C[C@H](N)C(=O)[O-] |
| InChI | InChI=1S/C5H8ClNO2/c1-3(6)2-4(7)5(8)9/h4H,1-2,7H2,(H,8,9)/p-1/t4-/m0/s1 |
| InChIKey | WLZNZXQYFWOBGU-BYPYZUCNSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-2-amino-4-chloropent-4-enoate (CHEBI:32819) has functional parent pent-4-enoate (CHEBI:35935) |
| L-2-amino-4-chloropent-4-enoate (CHEBI:32819) is a L-α-amino acid anion (CHEBI:59814) |
| L-2-amino-4-chloropent-4-enoate (CHEBI:32819) is conjugate base of L-2-amino-4-chloropent-4-enoic acid (CHEBI:15885) |
| Incoming Relation(s) |
| L-2-amino-4-chloropent-4-enoic acid (CHEBI:15885) is conjugate acid of L-2-amino-4-chloropent-4-enoate (CHEBI:32819) |
| IUPAC Name |
|---|
| (2S)-2-amino-4-chloropent-4-enoate |