EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:15674 - 2,3-dihydroxybutanedioic acid
| Formula | C4H6O6 |
| Net Charge | 0 |
| Average Mass | 150.086 |
| Monoisotopic Mass | 150.01644 |
| SMILES | O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | FEWJPZIEWOKRBE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-dihydroxybutanedioic acid (CHEBI:15674) has role human xenobiotic metabolite (CHEBI:76967) |
| 2,3-dihydroxybutanedioic acid (CHEBI:15674) has role plant metabolite (CHEBI:76924) |
| 2,3-dihydroxybutanedioic acid (CHEBI:15674) is a tetraric acid (CHEBI:26933) |
| 2,3-dihydroxybutanedioic acid (CHEBI:15674) is conjugate acid of 3-carboxy-2,3-dihydroxypropanoate (CHEBI:48929) |
| Incoming Relation(s) |
| fertaric acid (CHEBI:91032) has functional parent 2,3-dihydroxybutanedioic acid (CHEBI:15674) |
| meso-tartaric acid (CHEBI:15673) is a 2,3-dihydroxybutanedioic acid (CHEBI:15674) |
| D-tartaric acid (CHEBI:15672) is a 2,3-dihydroxybutanedioic acid (CHEBI:15674) |
| L-tartaric acid (CHEBI:15671) is a 2,3-dihydroxybutanedioic acid (CHEBI:15674) |
| 3-carboxy-2,3-dihydroxypropanoate (CHEBI:48929) is conjugate base of 2,3-dihydroxybutanedioic acid (CHEBI:15674) |
| IUPAC Name |
|---|
| 2,3-dihydroxybutanedioic acid |
| Synonyms | Source |
|---|---|
| 2,3-dihydroxysuccinic acid | ChEBI |
| tartaric acid (unspecified stereochemistry) | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Tartaric_Acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:526-83-0 | ChEBI |