EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6O6 |
| Net Charge | 0 |
| Average Mass | 150.086 |
| Monoisotopic Mass | 150.01644 |
| SMILES | O=C(O)[C@@H](O)[C@H](O)C(=O)O |
| InChI | InChI=1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)/t1-,2-/m0/s1 |
| InChIKey | FEWJPZIEWOKRBE-LWMBPPNESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-tartaric acid (CHEBI:15672) has role Escherichia coli metabolite (CHEBI:76971) |
| D-tartaric acid (CHEBI:15672) is a 2,3-dihydroxybutanedioic acid (CHEBI:15674) |
| D-tartaric acid (CHEBI:15672) is conjugate acid of D-tartrate(1−) (CHEBI:35399) |
| D-tartaric acid (CHEBI:15672) is enantiomer of L-tartaric acid (CHEBI:15671) |
| Incoming Relation(s) |
| (2S,3S)-cis-fertaric acid (CHEBI:76118) has functional parent D-tartaric acid (CHEBI:15672) |
| (2S,3S)-trans-fertaric acid (CHEBI:76120) has functional parent D-tartaric acid (CHEBI:15672) |
| DL-tartaric acid (CHEBI:26849) has part D-tartaric acid (CHEBI:15672) |
| D-tartrate(1−) (CHEBI:35399) is conjugate base of D-tartaric acid (CHEBI:15672) |
| L-tartaric acid (CHEBI:15671) is enantiomer of D-tartaric acid (CHEBI:15672) |
| IUPAC Name |
|---|
| (2S,3S)-2,3-dihydroxybutanedioic acid |
| Synonyms | Source |
|---|---|
| (2S,3S)-2,3-dihydroxysuccinic acid | ChEBI |
| (2S,3S)-(−)-tartaric acid | ChemIDplus |
| (2S,3S)-tartaric acid | IUPAC |
| D-Tartaric acid | KEGG COMPOUND |
| D(-)-TARTARIC ACID | PDBeChem |
| (S,S)-(−)-tartaric acid | ChemIDplus |
| Citations |
|---|