EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14O9 |
| Net Charge | 0 |
| Average Mass | 326.257 |
| Monoisotopic Mass | 326.06378 |
| SMILES | COc1cc(C=CC(=O)OC(C(=O)O)C(O)C(=O)O)ccc1O |
| InChI | InChI=1S/C14H14O9/c1-22-9-6-7(2-4-8(9)15)3-5-10(16)23-12(14(20)21)11(17)13(18)19/h2-6,11-12,15,17H,1H3,(H,18,19)(H,20,21) |
| InChIKey | XIWXUSFCUBAMFH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Vitis vinifera (ncbitaxon:29760) | |||
| - | MetaboLights (MTBLS55) | ||
| - | DOI (10.1007/s11306-014-0638-x) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fertaric acid (CHEBI:91032) has functional parent 2,3-dihydroxybutanedioic acid (CHEBI:15674) |
| fertaric acid (CHEBI:91032) is a aromatic ether (CHEBI:35618) |
| fertaric acid (CHEBI:91032) is a cinnamate ester (CHEBI:36087) |
| fertaric acid (CHEBI:91032) is a dicarboxylic acid (CHEBI:35692) |
| fertaric acid (CHEBI:91032) is a phenols (CHEBI:33853) |
| fertaric acid (CHEBI:91032) is a tetraric acid derivative (CHEBI:63440) |
| Incoming Relation(s) |
| (2R,3R)-cis-fertaric acid (CHEBI:76115) is a fertaric acid (CHEBI:91032) |
| (2R,3R)-trans-fertaric acid (CHEBI:76116) is a fertaric acid (CHEBI:91032) |
| (2S,3S)-cis-fertaric acid (CHEBI:76118) is a fertaric acid (CHEBI:91032) |
| (2S,3S)-trans-fertaric acid (CHEBI:76120) is a fertaric acid (CHEBI:91032) |
| IUPAC Name |
|---|
| 2-hydroxy-3-{[3-(4-hydroxy-3-methoxyphenyl)acryloyl]oxy}butanedioic acid |
| Synonyms | Source |
|---|---|
| fertaric acids | ChEBI |
| feruloyltartaric acid | ChEBI |