EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12O9 |
| Net Charge | 0 |
| Average Mass | 312.230 |
| Monoisotopic Mass | 312.04813 |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)O[C@H](C(=O)O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C13H12O9/c14-7-3-1-6(5-8(7)15)2-4-9(16)22-11(13(20)21)10(17)12(18)19/h1-5,10-11,14-15,17H,(H,18,19)(H,20,21)/b4-2+/t10-,11+/m1/s1 |
| InChIKey | SWGKAHCIOQPKFW-BOCAPUTCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S,3R)-trans-caftaric acid (CHEBI:76075) has functional parent meso-tartaric acid (CHEBI:15673) |
| (2S,3R)-trans-caftaric acid (CHEBI:76075) has functional parent trans-caffeic acid (CHEBI:16433) |
| (2S,3R)-trans-caftaric acid (CHEBI:76075) has role metabolite (CHEBI:25212) |
| (2S,3R)-trans-caftaric acid (CHEBI:76075) is a catechols (CHEBI:33566) |
| (2S,3R)-trans-caftaric acid (CHEBI:76075) is a cinnamate ester (CHEBI:36087) |
| (2S,3R)-trans-caftaric acid (CHEBI:76075) is a dicarboxylic acid (CHEBI:35692) |
| (2S,3R)-trans-caftaric acid (CHEBI:76075) is a tetraric acid derivative (CHEBI:63440) |
| IUPAC Name |
|---|
| (2S,3R)-2-{[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-3-hydroxybutanedioic acid |
| Synonyms | Source |
|---|---|
| (2S,3R)-trans-caffeoyl tartaric acid | ChEBI |
| trans-caftaric acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7144049 | Reaxys |