EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H27NO9 |
| Net Charge | 0 |
| Average Mass | 485.489 |
| Monoisotopic Mass | 485.16858 |
| SMILES | CC(O)[C@]1(N)Cc2c(O)c3c(c(O)c2[C@@H](O[C@H]2C[C@H](O)[C@H](O)CO2)C1)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C25H27NO9/c1-10(27)25(26)7-13-18(16(8-25)35-17-6-14(28)15(29)9-34-17)24(33)20-19(23(13)32)21(30)11-4-2-3-5-12(11)22(20)31/h2-5,10,14-17,27-29,32-33H,6-9,26H2,1H3/t10?,14-,15+,16-,17-,25-/m0/s1 |
| InChIKey | HSDGDISMODBEAN-UPOFGPJLSA-N |
| Roles Classification |
|---|
| Biological Roles: | topoisomerase II inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase II. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amrubicinol (CHEBI:156204) has functional parent amrubicin (CHEBI:135779) |
| amrubicinol (CHEBI:156204) has role antineoplastic agent (CHEBI:35610) |
| amrubicinol (CHEBI:156204) has role apoptosis inducer (CHEBI:68495) |
| amrubicinol (CHEBI:156204) has role topoisomerase II inhibitor (CHEBI:156203) |
| amrubicinol (CHEBI:156204) is a diastereoisomeric mixture (CHEBI:60915) |
| amrubicinol (CHEBI:156204) is a quinone (CHEBI:36141) |
| amrubicinol (CHEBI:156204) is a secondary alcohol (CHEBI:35681) |
| amrubicinol (CHEBI:156204) is a tetracenes (CHEBI:51270) |
| IUPAC Name |
|---|
| (7S,9S)-9-amino-7-{[(2S,4S,5R)-4,5-dihydroxytetrahydro-2H-pyran-2-yl]oxy}-6,11-dihydroxy-9-(1-hydroxyethyl)-7,8,9,10-tetrahydrotetracene-5,12-dione |
| Citations |
|---|