EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H25NO9 |
| Net Charge | 0 |
| Average Mass | 483.473 |
| Monoisotopic Mass | 483.15293 |
| SMILES | CC(=O)[C@]1(N)Cc2c(O)c3c(c(O)c2[C@@H](O[C@H]2C[C@H](O)[C@H](O)CO2)C1)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C25H25NO9/c1-10(27)25(26)7-13-18(16(8-25)35-17-6-14(28)15(29)9-34-17)24(33)20-19(23(13)32)21(30)11-4-2-3-5-12(11)22(20)31/h2-5,14-17,28-29,32-33H,6-9,26H2,1H3/t14-,15+,16-,17-,25-/m0/s1 |
| InChIKey | VJZITPJGSQKZMX-XDPRQOKASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | topoisomerase II inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase II. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amrubicin (CHEBI:135779) has role antineoplastic agent (CHEBI:35610) |
| amrubicin (CHEBI:135779) has role prodrug (CHEBI:50266) |
| amrubicin (CHEBI:135779) has role topoisomerase II inhibitor (CHEBI:156203) |
| amrubicin (CHEBI:135779) is a anthracycline antibiotic (CHEBI:49322) |
| amrubicin (CHEBI:135779) is a methyl ketone (CHEBI:51867) |
| amrubicin (CHEBI:135779) is a primary amino compound (CHEBI:50994) |
| amrubicin (CHEBI:135779) is a quinone (CHEBI:36141) |
| amrubicin (CHEBI:135779) is a tetracenes (CHEBI:51270) |
| Incoming Relation(s) |
| amrubicinol (CHEBI:156204) has functional parent amrubicin (CHEBI:135779) |
| IUPAC Name |
|---|
| (1S,3S)-3-acetyl-3-amino-5,12-dihydroxy-6,11-dioxo-1,2,3,4,6,11-hexahydrotetracen-1-yl 2-deoxy-β-D-erythro-pentopyranoside |
| INNs | Source |
|---|---|
| amrubicin | ChEBI |
| amrubicina | ChEBI |
| amrubicine | ChEBI |
| amrubicinum | ChEBI |
| Synonyms | Source |
|---|---|
| (7S,9S)-9-acetyl-9-amino-7-{[(2S,4S,5R)-4,5-dihydroxytetrahydro-2H-pyran-2-yl]oxy}-6,11-dihydroxy-7,8,9,10-tetrahydrotetracene-5,12-dione | IUPAC |
| SM-5887 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:110267-81-7 | DrugCentral |
| CAS:110267-81-7 | ChemIDplus |
| Citations |
|---|