EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8N2 |
| Net Charge | 0 |
| Average Mass | 156.188 |
| Monoisotopic Mass | 156.06875 |
| SMILES | N#CCc1cnc2ccccc12 |
| InChI | InChI=1S/C10H8N2/c11-6-5-8-7-12-10-4-2-1-3-9(8)10/h1-4,7,12H,5H2 |
| InChIKey | DMCPFOBLJMLSNX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. auxin Any of a group of compounds, both naturally occurring and synthetic, that induce cell elongation in plant stems (from Greek αυξανω, "to grow"). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indole-3-acetonitrile (CHEBI:17566) has functional parent acetonitrile (CHEBI:38472) |
| indole-3-acetonitrile (CHEBI:17566) has role auxin (CHEBI:22676) |
| indole-3-acetonitrile (CHEBI:17566) has role human xenobiotic metabolite (CHEBI:76967) |
| indole-3-acetonitrile (CHEBI:17566) has role plant hormone (CHEBI:37848) |
| indole-3-acetonitrile (CHEBI:17566) has role plant metabolite (CHEBI:76924) |
| indole-3-acetonitrile (CHEBI:17566) is a indoles (CHEBI:24828) |
| indole-3-acetonitrile (CHEBI:17566) is a nitrile (CHEBI:18379) |
| Incoming Relation(s) |
| L-Cys(IAN) (CHEBI:64988) has functional parent indole-3-acetonitrile (CHEBI:17566) |
| Cappariloside A (CHEBI:142256) has functional parent indole-3-acetonitrile (CHEBI:17566) |
| Cys(IAN)-Gly (CHEBI:137676) has functional parent indole-3-acetonitrile (CHEBI:17566) |
| γGluCys(IAN) (CHEBI:65022) has functional parent indole-3-acetonitrile (CHEBI:17566) |
| γGluCys(IAN)Glu (CHEBI:64978) has functional parent indole-3-acetonitrile (CHEBI:17566) |
| γGluCys(IAN)Gly (CHEBI:64980) has functional parent indole-3-acetonitrile (CHEBI:17566) |
| IUPAC Name |
|---|
| 1H-indol-3-ylacetonitrile |
| Synonyms | Source |
|---|---|
| 3-(cyanomethyl)indole | NIST Chemistry WebBook |
| 3-Indoleacetonitrile | KEGG COMPOUND |
| 3-indolylacetonitrile | ChemIDplus |
| (Indol-3-yl)acetonitrile | KEGG COMPOUND |
| Indol-3-ylacetonitrile | KEGG COMPOUND |
| Indole-3-acetonitrile | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (indol-3-yl)acetonitrile | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00000107 | KNApSAcK |
| C02938 | KEGG COMPOUND |
| HMDB0006524 | HMDB |
| INDOLEYL-CPD | MetaCyc |
| Citations |
|---|