EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H13N3O2S |
| Net Charge | 0 |
| Average Mass | 275.333 |
| Monoisotopic Mass | 275.07285 |
| SMILES | N#CC(SC[C@H](N)C(=O)O)c1cnc2ccccc12 |
| InChI | InChI=1S/C13H13N3O2S/c14-5-12(19-7-10(15)13(17)18)9-6-16-11-4-2-1-3-8(9)11/h1-4,6,10,12,16H,7,15H2,(H,17,18)/t10-,12?/m0/s1 |
| InChIKey | XNBDZHNCVGUXMR-NUHJPDEHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-Cys(IAN) (CHEBI:64988) has functional parent indole-3-acetonitrile (CHEBI:17566) |
| L-Cys(IAN) (CHEBI:64988) has role plant metabolite (CHEBI:76924) |
| L-Cys(IAN) (CHEBI:64988) is a S-conjugate (CHEBI:64987) |
| L-Cys(IAN) (CHEBI:64988) is a L-cysteine thioether (CHEBI:27532) |
| L-Cys(IAN) (CHEBI:64988) is a indoles (CHEBI:24828) |
| L-Cys(IAN) (CHEBI:64988) is a nitrile (CHEBI:18379) |
| L-Cys(IAN) (CHEBI:64988) is tautomer of L-Cys(IAN) zwitterion (CHEBI:79191) |
| Incoming Relation(s) |
| L-Cys(IAN) zwitterion (CHEBI:79191) is tautomer of L-Cys(IAN) (CHEBI:64988) |
| IUPAC Name |
|---|
| S-[cyano(1H-indol-3-yl)methyl]-L-cysteine |
| Synonyms | Source |
|---|---|
| IAN-cysteine conjugate | MetaCyc |
| indole-3-acetonitrile-cysteine conjugate | MetaCyc |
| Cys(IAN) | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-12636 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24684542 | Reaxys |
| Citations |
|---|