EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23N5O6S |
| Net Charge | 0 |
| Average Mass | 461.500 |
| Monoisotopic Mass | 461.13690 |
| SMILES | N#CC(SC[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)NCC(=O)O)c1cnc2ccccc12 |
| InChI | InChI=1S/C20H23N5O6S/c21-7-16(12-8-23-14-4-2-1-3-11(12)14)32-10-15(19(29)24-9-18(27)28)25-17(26)6-5-13(22)20(30)31/h1-4,8,13,15-16,23H,5-6,9-10,22H2,(H,24,29)(H,25,26)(H,27,28)(H,30,31)/t13-,15-,16?/m0/s1 |
| InChIKey | IYKWLNJKMRZQJG-JFXOEICMSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γGluCys(IAN)Gly (CHEBI:64980) has functional parent indole-3-acetonitrile (CHEBI:17566) |
| γGluCys(IAN)Gly (CHEBI:64980) has role metabolite (CHEBI:25212) |
| γGluCys(IAN)Gly (CHEBI:64980) is a glutathione conjugate (CHEBI:24335) |
| γGluCys(IAN)Gly (CHEBI:64980) is a indoles (CHEBI:24828) |
| γGluCys(IAN)Gly (CHEBI:64980) is a nitrile (CHEBI:18379) |
| γGluCys(IAN)Gly (CHEBI:64980) is conjugate acid of γGluCys(IAN)Gly(1−) (CHEBI:64981) |
| Incoming Relation(s) |
| γGluCys(IAN)Gly(1−) (CHEBI:64981) is conjugate base of γGluCys(IAN)Gly (CHEBI:64980) |
| IUPAC Name |
|---|
| L-γ-glutamyl-S-[cyano(1H-indol-3-yl)methyl]-L-cysteinylglycine |
| Synonym | Source |
|---|---|
| IAN-glutathione conjugate | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| CPD-12634 | MetaCyc |
| Citations |
|---|