EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16N4O3S |
| Net Charge | 0 |
| Average Mass | 332.385 |
| Monoisotopic Mass | 332.09431 |
| SMILES | N#CC(SC[C@H](N)C(=O)NCC(=O)O)c1cnc2ccccc12 |
| InChI | InChI=1S/C15H16N4O3S/c16-5-13(10-6-18-12-4-2-1-3-9(10)12)23-8-11(17)15(22)19-7-14(20)21/h1-4,6,11,13,18H,7-8,17H2,(H,19,22)(H,20,21)/t11-,13?/m0/s1 |
| InChIKey | KRSCQOPJLNSQDL-AMGKYWFPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cys(IAN)-Gly (CHEBI:137676) has functional parent L-cysteinylglycine (CHEBI:4047) |
| Cys(IAN)-Gly (CHEBI:137676) has functional parent indole-3-acetonitrile (CHEBI:17566) |
| Cys(IAN)-Gly (CHEBI:137676) is a S-conjugate (CHEBI:64987) |
| Cys(IAN)-Gly (CHEBI:137676) is a dipeptide (CHEBI:46761) |
| Cys(IAN)-Gly (CHEBI:137676) is a indoles (CHEBI:24828) |
| Cys(IAN)-Gly (CHEBI:137676) is a nitrile (CHEBI:18379) |
| Cys(IAN)-Gly (CHEBI:137676) is tautomer of Cys(IAN)-Gly zwitterion (CHEBI:136832) |
| Incoming Relation(s) |
| Cys(IAN)-Gly zwitterion (CHEBI:136832) is tautomer of Cys(IAN)-Gly (CHEBI:137676) |
| IUPAC Name |
|---|
| S-[cyano(1H-indol-3-yl)methyl]-L-cysteinylglycine |
| Synonyms | Source |
|---|---|
| L-Cys(IAN)-Gly | ChEBI |
| 2-(glycyl--S-yl)-2-(1H-indol-3-yl)-acetonitrile | MetaCyc |
| IAN-glycylcysteine conjugate | ChEBI |
| indole-3-acetonitrile-glycylcysteine conjugate | MetaCyc |
| S-[cyano(indol-3-yl)methyl]cysteinylglycine | ChEBI |
| S-[cyano(indol-3-yl)methyl]-L-cysteinylglycine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-12635 | MetaCyc |