EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20N4O5S |
| Net Charge | 0 |
| Average Mass | 404.448 |
| Monoisotopic Mass | 404.11544 |
| SMILES | N#CC(SC[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)O)c1cnc2ccccc12 |
| InChI | InChI=1S/C18H20N4O5S/c19-7-15(11-8-21-13-4-2-1-3-10(11)13)28-9-14(18(26)27)22-16(23)6-5-12(20)17(24)25/h1-4,8,12,14-15,21H,5-6,9,20H2,(H,22,23)(H,24,25)(H,26,27)/t12-,14-,15?/m0/s1 |
| InChIKey | FGSKBDHSKRORJJ-XRJCJLGXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γGluCys(IAN) (CHEBI:65022) has functional parent gamma-glutamylcysteine (CHEBI:24195) |
| γGluCys(IAN) (CHEBI:65022) has functional parent indole-3-acetonitrile (CHEBI:17566) |
| γGluCys(IAN) (CHEBI:65022) has role metabolite (CHEBI:25212) |
| γGluCys(IAN) (CHEBI:65022) is a S-conjugate (CHEBI:64987) |
| γGluCys(IAN) (CHEBI:65022) is a dipeptide (CHEBI:46761) |
| γGluCys(IAN) (CHEBI:65022) is a indoles (CHEBI:24828) |
| γGluCys(IAN) (CHEBI:65022) is a nitrile (CHEBI:18379) |
| IUPAC Name |
|---|
| L-γ-glutamyl-S-[cyano(1H-indol-3-yl)methyl]-L-cysteine |
| Synonyms | Source |
|---|---|
| indole-3-acetonitrile-L-γ-glutamyl-L-cysteine conjugate | ChEBI |
| indole-3-acetonitrile-γ-glutamylcysteine conjugate | ChEBI |
| L-γ-Glu-L-Cys-(IAN) | ChEBI |
| Citations |
|---|