EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O5 |
| Net Charge | 0 |
| Average Mass | 352.471 |
| Monoisotopic Mass | 352.22497 |
| SMILES | [H][C@]12C[C@@H](O)[C@H](/C=C/[C@@H](O)CCCCC)[C@@]1([H])C/C(=C/CCCC(=O)O)O2 |
| InChI | InChI=1S/C20H32O5/c1-2-3-4-7-14(21)10-11-16-17-12-15(8-5-6-9-20(23)24)25-19(17)13-18(16)22/h8,10-11,14,16-19,21-22H,2-7,9,12-13H2,1H3,(H,23,24)/b11-10+,15-8-/t14-,16+,17+,18+,19-/m0/s1 |
| InChIKey | KAQKFAOMNZTLHT-OZUDYXHBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin I2 (CHEBI:15552) has role mouse metabolite (CHEBI:75771) |
| prostaglandin I2 (CHEBI:15552) is a prostaglandins I (CHEBI:26345) |
| prostaglandin I2 (CHEBI:15552) is conjugate acid of prostaglandin I2(1−) (CHEBI:57403) |
| Incoming Relation(s) |
| 15-dehydro-prostaglandin I2 (CHEBI:15556) has functional parent prostaglandin I2 (CHEBI:15552) |
| 19-hydroxyprostaglandin I2 (CHEBI:138582) has functional parent prostaglandin I2 (CHEBI:15552) |
| prostaglandin I2 2-glyceryl ester (CHEBI:137176) has functional parent prostaglandin I2 (CHEBI:15552) |
| prostaglandin I2(1−) (CHEBI:57403) is conjugate base of prostaglandin I2 (CHEBI:15552) |
| IUPAC Name |
|---|
| (5Z,13E,15S)-6,9α-epoxy-11α,15-dihydroxyprosta-5,13-dienoic acid |
| Synonyms | Source |
|---|---|
| (5Z,9α,11α,13E,15S)-6,9-epoxy-11,15-dihydroxyprosta-5,13-dien-1-oic acid | ChemIDplus |
| (5Z,13E)-(15S)-6,9alpha-Epoxy-11alpha,15-dihydroxyprosta-5,13-dienoate | KEGG COMPOUND |
| (5Z,13E)-(15S)-6,9alpha-Epoxy-11alpha,15-dihydroxyprosta-5,13-dienoate | KEGG COMPOUND |
| Epoprostenol | KEGG COMPOUND |
| Flolan | ChemIDplus |
| PGI2 | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 1034 | DrugCentral |
| C01312 | KEGG COMPOUND |
| D00106 | KEGG DRUG |
| DB01240 | DrugBank |
| LMFA03010087 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1690090 | Beilstein |
| CAS:35121-78-9 | KEGG COMPOUND |
| CAS:35121-78-9 | ChemIDplus |