EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O5 |
| Net Charge | 0 |
| Average Mass | 352.471 |
| Monoisotopic Mass | 352.22497 |
| SMILES | [H][C@]12C[C@@H](O)[C@H](/C=C/[C@@H](O)CCCCC)[C@@]1([H])C/C(=C/CCCC(=O)O)O2 |
| InChI | InChI=1S/C20H32O5/c1-2-3-4-7-14(21)10-11-16-17-12-15(8-5-6-9-20(23)24)25-19(17)13-18(16)22/h8,10-11,14,16-19,21-22H,2-7,9,12-13H2,1H3,(H,23,24)/b11-10+,15-8-/t14-,16+,17+,18+,19-/m0/s1 |
| InChIKey | KAQKFAOMNZTLHT-OZUDYXHBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. anticoagulant An agent that prevents blood clotting. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin I2 (CHEBI:15552) has role anticoagulant (CHEBI:50249) |
| prostaglandin I2 (CHEBI:15552) has role antihypertensive agent (CHEBI:35674) |
| prostaglandin I2 (CHEBI:15552) has role antiviral agent (CHEBI:22587) |
| prostaglandin I2 (CHEBI:15552) has role mouse metabolite (CHEBI:75771) |
| prostaglandin I2 (CHEBI:15552) has role neuroprotective agent (CHEBI:63726) |
| prostaglandin I2 (CHEBI:15552) is a prostaglandins I (CHEBI:26345) |
| prostaglandin I2 (CHEBI:15552) is conjugate acid of prostaglandin I2(1−) (CHEBI:57403) |
| Incoming Relation(s) |
| 15-dehydro-prostaglandin I2 (CHEBI:15556) has functional parent prostaglandin I2 (CHEBI:15552) |
| 19-hydroxyprostaglandin I2 (CHEBI:138582) has functional parent prostaglandin I2 (CHEBI:15552) |
| prostaglandin I2 2-glyceryl ester (CHEBI:137176) has functional parent prostaglandin I2 (CHEBI:15552) |
| prostaglandin I2(1−) (CHEBI:57403) is conjugate base of prostaglandin I2 (CHEBI:15552) |
| IUPAC Name |
|---|
| (5Z,13E,15S)-6,9α-epoxy-11α,15-dihydroxyprosta-5,13-dienoic acid |
| Synonyms | Source |
|---|---|
| (5Z,9α,11α,13E,15S)-6,9-epoxy-11,15-dihydroxyprosta-5,13-dien-1-oic acid | ChemIDplus |
| (5Z,13E)-(15S)-6,9alpha-Epoxy-11alpha,15-dihydroxyprosta-5,13-dienoate | KEGG COMPOUND |
| (5Z,13E)-(15S)-6,9alpha-Epoxy-11alpha,15-dihydroxyprosta-5,13-dienoate | KEGG COMPOUND |
| ACT-385781A | ChEMBL |
| epoprostenol | ChEMBL |
| Epoprostenol | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 1034 | DrugCentral |
| C01312 | KEGG COMPOUND |
| D00106 | KEGG DRUG |
| DB01240 | DrugBank |
| LMFA03010087 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1690090 | Beilstein |
| CAS:35121-78-9 | KEGG COMPOUND |
| CAS:35121-78-9 | ChemIDplus |
| Citations |
|---|