EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H31O5 |
| Net Charge | -1 |
| Average Mass | 351.463 |
| Monoisotopic Mass | 351.21770 |
| SMILES | [H][C@]12C[C@@H](O)[C@H](/C=C/[C@@H](O)CCCCC)[C@@]1([H])C/C(=C/CCCC(=O)[O-])O2 |
| InChI | InChI=1S/C20H32O5/c1-2-3-4-7-14(21)10-11-16-17-12-15(8-5-6-9-20(23)24)25-19(17)13-18(16)22/h8,10-11,14,16-19,21-22H,2-7,9,12-13H2,1H3,(H,23,24)/p-1/b11-10+,15-8-/t14-,16+,17+,18+,19-/m0/s1 |
| InChIKey | KAQKFAOMNZTLHT-OZUDYXHBSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin I2(1−) (CHEBI:57403) has role human metabolite (CHEBI:77746) |
| prostaglandin I2(1−) (CHEBI:57403) is a prostaglandin carboxylic acid anion (CHEBI:59326) |
| prostaglandin I2(1−) (CHEBI:57403) is conjugate base of prostaglandin I2 (CHEBI:15552) |
| Incoming Relation(s) |
| 19-hydroxyprostaglandin I2(1−) (CHEBI:137987) has functional parent prostaglandin I2(1−) (CHEBI:57403) |
| prostaglandin I2 (CHEBI:15552) is conjugate acid of prostaglandin I2(1−) (CHEBI:57403) |
| IUPAC Name |
|---|
| (5Z,13E,15S)-6,9α-epoxy-11α,15-dihydroxyprosta-5,13-dienoate |
| Synonym | Source |
|---|---|
| prostaglandin I2 anion | ChEBI |
| UniProt Name | Source |
|---|---|
| prostaglandin I2 | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8135954 | Beilstein |