EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O6 |
| Net Charge | 0 |
| Average Mass | 368.470 |
| Monoisotopic Mass | 368.21989 |
| SMILES | [H][C@]12C[C@@H](O)[C@H](/C=C/[C@@H](O)CCCC(C)O)[C@@]1([H])C/C(=C/CCCC(=O)O)O2 |
| InChI | InChI=1S/C20H32O6/c1-13(21)5-4-6-14(22)9-10-16-17-11-15(7-2-3-8-20(24)25)26-19(17)12-18(16)23/h7,9-10,13-14,16-19,21-23H,2-6,8,11-12H2,1H3,(H,24,25)/b10-9+,15-7-/t13?,14-,16+,17+,18+,19-/m0/s1 |
| InChIKey | PGRXDTJFXIPRSO-QAQUDUTNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (15789615) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 19-hydroxyprostaglandin I2 (CHEBI:138582) has functional parent prostaglandin I2 (CHEBI:15552) |
| 19-hydroxyprostaglandin I2 (CHEBI:138582) has role human xenobiotic metabolite (CHEBI:76967) |
| 19-hydroxyprostaglandin I2 (CHEBI:138582) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| 19-hydroxyprostaglandin I2 (CHEBI:138582) is a prostaglandins I (CHEBI:26345) |
| 19-hydroxyprostaglandin I2 (CHEBI:138582) is a secondary allylic alcohol (CHEBI:134396) |
| 19-hydroxyprostaglandin I2 (CHEBI:138582) is a triol (CHEBI:27136) |
| 19-hydroxyprostaglandin I2 (CHEBI:138582) is conjugate acid of 19-hydroxyprostaglandin I2(1−) (CHEBI:137987) |
| Incoming Relation(s) |
| 19-hydroxyprostaglandin I2(1−) (CHEBI:137987) is conjugate base of 19-hydroxyprostaglandin I2 (CHEBI:138582) |
| IUPAC Name |
|---|
| (5Z,13E,15S)-11α,15,19-trihydroxy-6,9α-epoxyprosta-5,13-dien-1-oic acid |
| Synonyms | Source |
|---|---|
| 19-hydroxy-PGI2 | ChEBI |
| (5Z,9α,11α,13E,15S)-11,15,19-trihydroxy-6,9-epoxyprosta-5,13-dien-1-oic acid | IUPAC |
| Citations |
|---|