EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O5 |
| Net Charge | 0 |
| Average Mass | 350.455 |
| Monoisotopic Mass | 350.20932 |
| SMILES | [H][C@]12C[C@@H](O)[C@H](/C=C/C(=O)CCCCC)[C@@]1([H])C/C(=C/CCCC(=O)O)O2 |
| InChI | InChI=1S/C20H30O5/c1-2-3-4-7-14(21)10-11-16-17-12-15(8-5-6-9-20(23)24)25-19(17)13-18(16)22/h8,10-11,16-19,22H,2-7,9,12-13H2,1H3,(H,23,24)/b11-10+,15-8-/t16-,17-,18-,19+/m1/s1 |
| InChIKey | YCLHGWBUIYKBPM-ABXKVQRYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15-dehydro-prostaglandin I2 (CHEBI:15556) has functional parent prostaglandin I2 (CHEBI:15552) |
| 15-dehydro-prostaglandin I2 (CHEBI:15556) is a prostaglandins I (CHEBI:26345) |
| 15-dehydro-prostaglandin I2 (CHEBI:15556) is conjugate acid of 15-dehydro-prostaglandin I2(1−) (CHEBI:57407) |
| Incoming Relation(s) |
| 15-dehydro-prostaglandin I2(1−) (CHEBI:57407) is conjugate base of 15-dehydro-prostaglandin I2 (CHEBI:15556) |
| IUPAC Name |
|---|
| (5Z,13E)-6,9α-epoxy-11α-hydroxy-15-oxoprosta-5,13-dienoic acid |
| Synonyms | Source |
|---|---|
| 15-deoxy-15-oxo-prostaglandin I2 | ChEBI |
| 15-Keto-pgi2 | ChemIDplus |
| 15-keto PGI2 | ChEBI |
| 15-Ketoprostaglandin I2 | ChemIDplus |
| (5Z,13E)-6,9alpha-Epoxy-11alpha-hydroxy-15-oxoprosta-5,13-dienoate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C04835 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:100311-07-7 | ChemIDplus |