EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7NO3 |
| Net Charge | 0 |
| Average Mass | 117.104 |
| Monoisotopic Mass | 117.04259 |
| SMILES | C/C(=C/N)C(=O)OO |
| InChI | InChI=1S/C4H7NO3/c1-3(2-5)4(6)8-7/h2,7H,5H2,1H3/b3-2- |
| InChIKey | DYYSAMFOJRGAMQ-IHWYPQMZSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-2-methyl-3-aminoperacrylic acid (CHEBI:63250) has functional parent (Z)-3-amino-2-methylacrylic acid (CHEBI:145742) |
| (Z)-2-methyl-3-aminoperacrylic acid (CHEBI:63250) is a peroxy acid (CHEBI:52094) |
| (Z)-2-methyl-3-aminoperacrylic acid (CHEBI:63250) is a primary amino compound (CHEBI:50994) |
| IUPAC Name |
|---|
| (2Z)-3-amino-2-methylprop-2-eneperoxoic acid |
| Synonym | Source |
|---|---|
| (Z)-2-methyl-3-peroxyaminoacrylate | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (Z)-2-methyl-3-aminoperacrylic acid | UniProt |
| Citations |
|---|