EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H17N2 |
| Net Charge | +1 |
| Average Mass | 201.293 |
| Monoisotopic Mass | 201.13862 |
| SMILES | c1ccc2c(c1)CCCC2C1=[NH+]CCN1 |
| InChI | InChI=1S/C13H16N2/c1-2-6-11-10(4-1)5-3-7-12(11)13-14-8-9-15-13/h1-2,4,6,12H,3,5,7-9H2,(H,14,15)/p+1 |
| InChIKey | BYJAVTDNIXVSPW-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetryzoline(1+) (CHEBI:145569) is a imidazolium ion (CHEBI:59964) |
| tetryzoline(1+) (CHEBI:145569) is conjugate acid of tetryzoline (CHEBI:28674) |
| Incoming Relation(s) |
| tetrahydrozoline hydrochloride (CHEBI:9492) has part tetryzoline(1+) (CHEBI:145569) |
| tetrahydrozoline nitrate (CHEBI:145570) has part tetryzoline(1+) (CHEBI:145569) |
| tetryzoline (CHEBI:28674) is conjugate base of tetryzoline(1+) (CHEBI:145569) |
| IUPAC Name |
|---|
| 2-(1,2,3,4-tetrahydronaphthalen-1-yl)-4,5-dihydro-1H-imidazol-3-ium |