EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:28674 - tetryzoline
| Formula | C13H16N2 |
| Net Charge | 0 |
| Average Mass | 200.285 |
| Monoisotopic Mass | 200.13135 |
| SMILES | c1ccc2c(c1)CCCC2C1=NCCN1 |
| InChI | InChI=1S/C13H16N2/c1-2-6-11-10(4-1)5-3-7-12(11)13-14-8-9-15-13/h1-2,4,6,12H,3,5,7-9H2,(H,14,15) |
| InChIKey | BYJAVTDNIXVSPW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. |
| Applications: | sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetryzoline (CHEBI:28674) has role nasal decongestant (CHEBI:77715) |
| tetryzoline (CHEBI:28674) has role sympathomimetic agent (CHEBI:35524) |
| tetryzoline (CHEBI:28674) is a carboxamidine (CHEBI:35359) |
| tetryzoline (CHEBI:28674) is a imidazolines (CHEBI:53095) |
| tetryzoline (CHEBI:28674) is conjugate base of tetryzoline(1+) (CHEBI:145569) |
| Incoming Relation(s) |
| tetryzoline(1+) (CHEBI:145569) is conjugate acid of tetryzoline (CHEBI:28674) |
| IUPAC Name |
|---|
| 2-(1,2,3,4-tetrahydronaphthalen-1-yl)-4,5-dihydro-1H-imidazole |
| INNs | Source |
|---|---|
| tetryzolinum | WHO MedNet |
| tetryzoline | WHO MedNet |
| téetryzoline | WHO MedNet |
| tetryzolina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Tetrahydrozoline | KEGG COMPOUND |
| 2-Tetralin-1-yl-4,5-dihydro-1H-imidazole | KEGG COMPOUND |
| Tetryzoline | KEGG COMPOUND |
| 4,5-dihydro-2-(1,2,3,4-tetrahydro-1-naphthalenyl)-1H-imidazole | NIST Chemistry WebBook |
| 2-(1,2,3,4-Tetrahydro-1-naphthyl)-2-imidazoline | NIST Chemistry WebBook |